Relevant Regulations and Standards
Prohexadione(F06324)
| Common Name | Prohexadione(F06324) |
| FRCD ID | F06324 |
| Formula | C10H12O5 |
| InChI Key | BUCOQPHDYUOJSI-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H12O5/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13/h5,9H,2-4H2,1H3,(H,14,15) |
| Canonical SMILES | CCC(=O)C1C(=O)CC(CC1=O)C(=O)O |
| Isomeric SMILES | CCC(=O)C1C(=O)CC(CC1=O)C(=O)O |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Cherries (sweet) (Black cherries, Capulins, Chokecherries, Cornelian cherries/European corniols, Nanking cherries, Sour cherries/morello cherries,) | 0140020 | European Union | 0.4 | 06/02/2018 | |
| Blueberries (Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Bearberries, Bilberries/European blueberries/whortleberries, Bog bilberries, European barberries, Golden currant/buffalo currant, Haskaps/blue honeysuckles, Huckleberries, Jostaberries, Juneberries, Myrtle berries, Native currant, Red bilberries/cowberries, Red bilberries/lingonberries, Salal/shallon berries, Sea buckthorns/sallow thorns, Serviceberries, Ugniberries/Chilean guavas, Worcesterberries, Other species and hybrids of genera Ribes and Vaccinium, not elsewhere mentioned,) | 0154010 | European Union | 0.01* | 06/02/2018 | |
| Aubergines/eggplants (Antroewas/African eggplants/gboma, Ethiopian eggplants/gilo', Pepinos, Thorn apples, Turkey berries/devil's figs/pea eggplants/pea aubergines, Kangaroo apples/poroporo,) | 0231030 | European Union | 0.01* | 06/02/2018 | |
| Cresses and other sprouts and shoots (Alfalfa/lucerne sprouts, Chinese chives/oriental garlic/garlic chives sprouts, Broccoli sprouts, Daikon/Japanese radish sprouts, Ginger shoots, Mung bean sprouts, Peas shoots and sprouts, Roman rocket/rucola sprouts, Soyabeans sprouts, Sunflower shoots and sprouts, Cereals grasses/cereals shoots, Other species used for the production of sprouts or shoots,) | 0251040 | European Union | 0.01* | 06/02/2018 | |
| Rose (Almond, Bee balm, Bitter orange/sour orange, Black locust, Cat’s foot, Chrysanthemum, Cinnamon, Clary sage, Cornflower, Cowslip/primrose, Daisy, Dyer’s broom, Elder, Field poppy, Great mullein, Hawthorn, Heather, Hollyhock, Horse-chestnut, Larkspur, Lavender, Mallow, Meadow sweet, Mullein, Orange, Peony, Red clover, Sacred lotus, Safflower, Sandy everlasting, St. John's wort, Sunflower, Sweet olive/sweet osmanthus, Sweet violet, White deadnettle, Yarrow, Ylang-ylang,) | 0631030 | European Union | 0.05* | 06/02/2018 | |
| (g) other farmed terrestrial animals (Alpaca, Bactrian camel, Capybara, Cottontail/American rabbit, Dromedary, Eland, Elk/moose, Emu, Fallow deer, Guinea pig, Hare (farmed), Llama, Nandu/greater rhea, Ostrich, Peccari (collared), Rabbit, Red deer, Reindeer, Roe deer, Other farmed terrestrial animals,) | 1017000 | European Union | 0.01* | 06/02/2018 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 06/02/2018 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 06/02/2018 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 06/02/2018 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 06/02/2018 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 06/02/2018 | |
| Figs | 0161020 | European Union | 0.01* | 06/02/2018 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.01* | 06/02/2018 | |
| Brazil nuts | 0120020 | European Union | 0.01* | 06/02/2018 | |
| Cashew nuts | 0120030 | European Union | 0.01* | 06/02/2018 | |
| Chestnuts | 0120040 | European Union | 0.01* | 06/02/2018 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.01* | 06/02/2018 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.01* | 06/02/2018 | |
| Macadamias | 0120070 | European Union | 0.01* | 06/02/2018 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.01* | 06/02/2018 |