Salbutamon
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0128 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Salbutamon |
| Molecular Chinese Name | 沙丁胺醇杂质 |
| 2D Structure | |
| CAS Number | 156547-62-5 |
| PubChem CID | 11601134 |
| Formula | C13H19NO3 |
| IUPAC Name | 2-(tert-butylamino)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone |
| InChI Key | WHJAFZHZZCVHJI-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H19NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,14-16H,7-8H2,1-3H3 |
| Canonical SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C=C1)O)CO |
| Isomeric SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C=C1)O)CO |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Salbutamon
UNII-T0IO19163J
156547-62-5
T0IO19163J
Albuterone
Salbutamone
Salbutamol sulfate impurity J [EP]
Salbutamol Impurity J
SCHEMBL6698305
Salbutamol impurity J [EP]
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:12 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 237.29 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Complexity | 260 |
| Monoisotopic Mass | 237.13649348 |
| Exact Mass | 237.13649348 |
| XLogP | 1.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.8866 |
| Human Intestinal Absorption | HIA+ | 0.9938 |
| Caco-2 Permeability | Caco2- | 0.5784 |
| P-glycoprotein Substrate | Substrate | 0.6126 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8566 |
| Non-inhibitor | 0.8922 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8464 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8638 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7724 |
| CYP450 2D6 Substrate | Non-substrate | 0.8792 |
| CYP450 3A4 Substrate | Non-substrate | 0.6505 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7917 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8561 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8790 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8210 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8414 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7493 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9726 |
| Non-inhibitor | 0.9399 | |
| AMES Toxicity | Non AMES toxic | 0.6267 |
| Carcinogens | Non-carcinogens | 0.8482 |
| Fish Toxicity | High FHMT | 0.5848 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9168 |
| Honey Bee Toxicity | High HBT | 0.5383 |
| Biodegradation | Not ready biodegradable | 0.9713 |
| Acute Oral Toxicity | III | 0.7437 |
| Carcinogenicity (Three-class) | Non-required | 0.4795 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -1.7853 | LogS |
| Caco-2 Permeability | 1.0513 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.3911 | LD50, mol/kg |
| Fish Toxicity | 1.3893 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.0557 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Salbutamol |
DrugBank, National Health Commission of the People's Republic of China, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
Link |
