Please enter a SMILES of illegal food additives or input molecular structure through the JSME editor. We will screen similar molecules from drugs, food additives, industrial chemicals, toxins, pesticides, and veterinary drugs, etc. These molecules are easily accessible and have the potential to be illegally added to food for the same purpose as inputted illegal additives.
Example: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C
Tips: This function needs to take a few minutes due to big dataset.