Fenspiride
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0161 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Fenspiride |
| Molecular Chinese Name | 芬司匹利 |
| 2D Structure | |
| CAS Number | 5053-06-5 |
| PubChem CID | 3344 |
| Formula | C15H20N2O2 |
| IUPAC Name | 8-(2-phenylethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| InChI Key | FVNFBBAOMBJTST-UHFFFAOYSA-N |
| InChI | InChI=1S/C15H20N2O2/c18-14-16-12-15(19-14)7-10-17(11-8-15)9-6-13-4-2-1-3-5-13/h1-5H,6-12H2,(H,16,18) |
| Canonical SMILES | C1CN(CCC12CNC(=O)O2)CCC3=CC=CC=C3 |
| Isomeric SMILES | C1CN(CCC12CNC(=O)O2)CCC3=CC=CC=C3 |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
5053-06-5
Fenspirid
Respiride
Viarespan
Fenspiride [INN]
Fenspiridum [INN-Latin]
UNII-S983QC7HKM
S983QC7HKM
Fenspiride
Fenspirida [INN-Spanish]
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:38 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 260.33 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Complexity | 318 |
| Monoisotopic Mass | 260.15247789 |
| Exact Mass | 260.15247789 |
| XLogP | 2.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9865 |
| Human Intestinal Absorption | HIA+ | 0.9952 |
| Caco-2 Permeability | Caco2- | 0.5443 |
| P-glycoprotein Substrate | Substrate | 0.5623 |
| P-glycoprotein Inhibitor | Inhibitor | 0.7291 |
| Non-inhibitor | 0.7224 | |
| Renal Organic Cation Transporter | Inhibitor | 0.5254 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.6753 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7942 |
| CYP450 2D6 Substrate | Non-substrate | 0.6669 |
| CYP450 3A4 Substrate | Substrate | 0.5691 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9046 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9372 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.6952 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8503 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8704 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Strong inhibitor | 0.5069 |
| Non-inhibitor | 0.6051 | |
| AMES Toxicity | Non AMES toxic | 0.6614 |
| Carcinogens | Non-carcinogens | 0.9484 |
| Fish Toxicity | High FHMT | 0.5397 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8074 |
| Honey Bee Toxicity | Low HBT | 0.6877 |
| Biodegradation | Not ready biodegradable | 0.9583 |
| Acute Oral Toxicity | III | 0.7932 |
| Carcinogenicity (Three-class) | Non-required | 0.5847 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.8798 | LogS |
| Caco-2 Permeability | 0.9530 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.4552 | LD50, mol/kg |
| Fish Toxicity | 1.5237 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.2217 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Fenspiride hydrochloride |
ToxCast & Tox21 Chemicals |
Link |
