Reproterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0163 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Reproterol |
| Molecular Chinese Name | 瑞普特罗 |
| 2D Structure | |
| CAS Number | 54063-54-6 |
| PubChem CID | 25654 |
| Formula | C18H23N5O5 |
| IUPAC Name | 7-[3-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]propyl]-1,3-dimethylpurine-2,6-dione |
| InChI Key | WVLAAKXASPCBGT-UHFFFAOYSA-N |
| InChI | InChI=1S/C18H23N5O5/c1-21-16-15(17(27)22(2)18(21)28)23(10-20-16)5-3-4-19-9-14(26)11-6-12(24)8-13(25)7-11/h6-8,10,14,19,24-26H,3-5,9H2,1-2H3 |
| Canonical SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCCNCC(C3=CC(=CC(=C3)O)O)O |
| Isomeric SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCCNCC(C3=CC(=CC(=C3)O)O)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Reproterol
54063-54-6
Reproterol [INN:BAN]
Reproterolum [INN-Latin]
EINECS 258-956-1
D 1959
BRN 0590567
1,2,3,6-Tetrahydro-1,3-dimethyl-7-(3-((beta,3,5-trihydroxyphenethyl)amino)propyl)-2,6-purindion
7-(3-((2-(3,5-Dihydroxyphenyl)-2-hydroxyethyl)amino)propyl)theophylline
7-(3-((beta,3,5-Trihydroxyphenethyl)amino)propyl)theophylline
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:39 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 389.4 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 7 |
| Complexity | 569 |
| Monoisotopic Mass | 389.16991886 |
| Exact Mass | 389.16991886 |
| XLogP | -0.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 28 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9684 |
| Human Intestinal Absorption | HIA+ | 0.9712 |
| Caco-2 Permeability | Caco2- | 0.7452 |
| P-glycoprotein Substrate | Substrate | 0.8645 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8539 |
| Non-inhibitor | 0.9380 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7863 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6413 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7521 |
| CYP450 2D6 Substrate | Non-substrate | 0.7963 |
| CYP450 3A4 Substrate | Substrate | 0.6448 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8228 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9031 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9393 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9040 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9604 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8844 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Strong inhibitor | 0.5476 |
| Inhibitor | 0.7210 | |
| AMES Toxicity | Non AMES toxic | 0.7788 |
| Carcinogens | Non-carcinogens | 0.8562 |
| Fish Toxicity | High FHMT | 0.6156 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9509 |
| Honey Bee Toxicity | Low HBT | 0.7826 |
| Biodegradation | Not ready biodegradable | 0.8699 |
| Acute Oral Toxicity | III | 0.5892 |
| Carcinogenicity (Three-class) | Non-required | 0.6632 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.4602 | LogS |
| Caco-2 Permeability | 0.2435 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.1221 | LD50, mol/kg |
| Fish Toxicity | 1.5861 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.3770 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Theodrenaline |
FRCD |
Link |
