Bitolterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0165 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Bitolterol |
| Molecular Chinese Name | 比托特罗 |
| 2D Structure | |
| CAS Number | 30392-40-6 |
| PubChem CID | 35330 |
| Formula | C28H31NO5 |
| IUPAC Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate |
| InChI Key | FZGVEKPRDOIXJY-UHFFFAOYSA-N |
| InChI | InChI=1S/C28H31NO5/c1-18-6-10-20(11-7-18)26(31)33-24-15-14-22(23(30)17-29-28(3,4)5)16-25(24)34-27(32)21-12-8-19(2)9-13-21/h6-16,23,29-30H,17H2,1-5H3 |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)OC2=C(C=C(C=C2)C(CNC(C)(C)C)O)OC(=O)C3=CC=C(C=C3)C |
| Isomeric SMILES | CC1=CC=C(C=C1)C(=O)OC2=C(C=C(C=C2)C(CNC(C)(C)C)O)OC(=O)C3=CC=C(C=C3)C |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Bitolterol
Bitolterolum
30392-40-6
Bitolterolum [INN-Latin]
Bitolterol [INN:BAN]
CHEBI:3133
C28H31NO5
WIN 32784
S 1540
4-(2-(tert-Butylamino)-1-hydroxyethyl-o-phenylene di-p-toluate
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:48 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 461.5 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 10 |
| Complexity | 658 |
| Monoisotopic Mass | 461.2202231 |
| Exact Mass | 461.2202231 |
| XLogP | 5.2 |
| Formal Charge | 0 |
| Heavy Atom Count | 34 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9679 |
| Human Intestinal Absorption | HIA+ | 0.8753 |
| Caco-2 Permeability | Caco2- | 0.7805 |
| P-glycoprotein Substrate | Substrate | 0.7533 |
| P-glycoprotein Inhibitor | Inhibitor | 0.5438 |
| Non-inhibitor | 0.7643 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9069 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8078 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7406 |
| CYP450 2D6 Substrate | Non-substrate | 0.7710 |
| CYP450 3A4 Substrate | Non-substrate | 0.5086 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8381 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8987 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8594 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9000 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7754 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8853 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9912 |
| Non-inhibitor | 0.7982 | |
| AMES Toxicity | Non AMES toxic | 0.9151 |
| Carcinogens | Non-carcinogens | 0.8648 |
| Fish Toxicity | High FHMT | 0.9897 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9946 |
| Honey Bee Toxicity | Low HBT | 0.5366 |
| Biodegradation | Not ready biodegradable | 0.9876 |
| Acute Oral Toxicity | III | 0.6084 |
| Carcinogenicity (Three-class) | Non-required | 0.6360 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.7208 | LogS |
| Caco-2 Permeability | -0.2551 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.3906 | LD50, mol/kg |
| Fish Toxicity | 0.3538 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.7280 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
BITOLTEROL MESYLATE |
National Health Commission of the People's Republic of China |
Link |
