Bambuterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0166 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Bambuterol |
| Molecular Chinese Name | 班布特罗 |
| 2D Structure | |
| CAS Number | 81732-65-2 |
| PubChem CID | 54766 |
| Formula | C18H29N3O5 |
| IUPAC Name | [3-[2-(tert-butylamino)-1-hydroxyethyl]-5-(dimethylcarbamoyloxy)phenyl] N,N-dimethylcarbamate |
| InChI Key | ANZXOIAKUNOVQU-UHFFFAOYSA-N |
| InChI | InChI=1S/C18H29N3O5/c1-18(2,3)19-11-15(22)12-8-13(25-16(23)20(4)5)10-14(9-12)26-17(24)21(6)7/h8-10,15,19,22H,11H2,1-7H3 |
| Canonical SMILES | CC(C)(C)NCC(C1=CC(=CC(=C1)OC(=O)N(C)C)OC(=O)N(C)C)O |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=CC(=C1)OC(=O)N(C)C)OC(=O)N(C)C)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Bambuterol
81732-65-2
Bambuterolum
Bambec
Bambuterolum [Latin]
Oxeol
C18H29N3O5
CHEBI:553827
5-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,3-diyl bis(dimethylcarbamate)
(+-)-5-(2-(tert-Butylamino)-1-hydroxyethyl)-m-phenylene bis(dimethylcarbamate)
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:48 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 367.4 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 8 |
| Complexity | 446 |
| Monoisotopic Mass | 367.21072105 |
| Exact Mass | 367.21072105 |
| XLogP | 1.2 |
| Formal Charge | 0 |
| Heavy Atom Count | 26 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.7610 |
| Human Intestinal Absorption | HIA+ | 0.8638 |
| Caco-2 Permeability | Caco2- | 0.6746 |
| P-glycoprotein Substrate | Substrate | 0.7076 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8708 |
| Non-inhibitor | 0.8921 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9451 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5928 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7745 |
| CYP450 2D6 Substrate | Non-substrate | 0.8167 |
| CYP450 3A4 Substrate | Non-substrate | 0.5157 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9155 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.8689 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9026 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9270 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9738 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9727 |
| Non-inhibitor | 0.9370 | |
| AMES Toxicity | Non AMES toxic | 0.7909 |
| Carcinogens | Non-carcinogens | 0.7620 |
| Fish Toxicity | High FHMT | 0.9342 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9553 |
| Honey Bee Toxicity | Low HBT | 0.5169 |
| Biodegradation | Not ready biodegradable | 0.9963 |
| Acute Oral Toxicity | III | 0.6060 |
| Carcinogenicity (Three-class) | Non-required | 0.6401 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.4162 | LogS |
| Caco-2 Permeability | 0.0658 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.5730 | LD50, mol/kg |
| Fish Toxicity | 0.9571 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1065 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Bambuterol hydrochloride |
ToxCast & Tox21 Chemicals |
Link |
