Carbuterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0175 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Carbuterol |
| Molecular Chinese Name | 卡布特罗 |
| 2D Structure | |
| CAS Number | 34866-47-2 |
| PubChem CID | 36976 |
| Formula | C13H21N3O3 |
| IUPAC Name | [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl]urea |
| InChI Key | KEMXXQOFIRIICG-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H21N3O3/c1-13(2,3)15-7-11(18)8-4-5-10(17)9(6-8)16-12(14)19/h4-6,11,15,17-18H,7H2,1-3H3,(H3,14,16,19) |
| Canonical SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)NC(=O)N)O |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)NC(=O)N)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
CARBUTEROL
34866-47-2
Carbuterol [INN:BAN]
Carbuterolum [INN-Latin]
EINECS 252-257-5
Carbuterolum
C13H21N3O3
SK&F-40383
Bronsecur
(5-(2-(tert-butylamino)-1-hydroxyethyl)-2-hydroxyphenyl)urea
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:49 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 267.32 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Complexity | 304 |
| Monoisotopic Mass | 267.15829155 |
| Exact Mass | 267.15829155 |
| XLogP | -0.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9243 |
| Human Intestinal Absorption | HIA+ | 0.9736 |
| Caco-2 Permeability | Caco2- | 0.7048 |
| P-glycoprotein Substrate | Substrate | 0.6455 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9749 |
| Non-inhibitor | 0.9893 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9531 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8046 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6594 |
| CYP450 2D6 Substrate | Non-substrate | 0.7445 |
| CYP450 3A4 Substrate | Non-substrate | 0.6166 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7424 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8617 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8836 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5890 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7101 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8464 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9787 |
| Non-inhibitor | 0.9531 | |
| AMES Toxicity | Non AMES toxic | 0.9132 |
| Carcinogens | Non-carcinogens | 0.7935 |
| Fish Toxicity | High FHMT | 0.7622 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9737 |
| Honey Bee Toxicity | Low HBT | 0.7120 |
| Biodegradation | Not ready biodegradable | 0.9908 |
| Acute Oral Toxicity | III | 0.6358 |
| Carcinogenicity (Three-class) | Non-required | 0.6217 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.0427 | LogS |
| Caco-2 Permeability | 0.3577 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.3737 | LD50, mol/kg |
| Fish Toxicity | 1.2264 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1411 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
