Arformoterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0176 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Arformoterol |
| Molecular Chinese Name | 福莫特罗 |
| 2D Structure | |
| CAS Number | 67346-49-0 |
| PubChem CID | 3083544 |
| Formula | C19H24N2O4 |
| IUPAC Name | N-[2-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenyl]formamide |
| InChI Key | BPZSYCZIITTYBL-YJYMSZOUSA-N |
| InChI | InChI=1S/C19H24N2O4/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22)/t13-,19+/m1/s1 |
| Canonical SMILES | CC(CC1=CC=C(C=C1)OC)NCC(C2=CC(=C(C=C2)O)NC=O)O |
| Isomeric SMILES | C[C@H](CC1=CC=C(C=C1)OC)NC[C@@H](C2=CC(=C(C=C2)O)NC=O)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Arformoterol
Formoterol
(R,R)-Formoterol
67346-49-0
73573-87-2
Brovana
Foradil
Atimos
(-)-Formoterol
UNII-F91H02EBWT
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:50 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 344.4 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 8 |
| Complexity | 388 |
| Monoisotopic Mass | 344.17360726 |
| Exact Mass | 344.17360726 |
| XLogP | 1.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.8026 |
| Human Intestinal Absorption | HIA+ | 0.8991 |
| Caco-2 Permeability | Caco2- | 0.6916 |
| P-glycoprotein Substrate | Substrate | 0.7470 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8773 |
| Non-inhibitor | 0.8561 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8818 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7680 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7140 |
| CYP450 2D6 Substrate | Non-substrate | 0.7086 |
| CYP450 3A4 Substrate | Substrate | 0.5556 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6609 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9070 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.8931 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.8994 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8757 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8442 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9611 |
| Non-inhibitor | 0.6602 | |
| AMES Toxicity | Non AMES toxic | 0.7517 |
| Carcinogens | Non-carcinogens | 0.8704 |
| Fish Toxicity | High FHMT | 0.9609 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9469 |
| Honey Bee Toxicity | Low HBT | 0.7820 |
| Biodegradation | Not ready biodegradable | 0.9920 |
| Acute Oral Toxicity | III | 0.6770 |
| Carcinogenicity (Three-class) | Non-required | 0.6926 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.7514 | LogS |
| Caco-2 Permeability | 0.3475 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.4047 | LD50, mol/kg |
| Fish Toxicity | 0.6216 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4807 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Arformoterol Tartrate |
National Health Commission of the People's Republic of China |
Link |
