Xanthan gum
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0177 |
| Substance Name | Thickening agent |
| Substance Chinese Name | 增稠剂 |
| Molecular Name | Xanthan gum |
| Molecular Chinese Name | 黄原胶 |
| 2D Structure | |
| CAS Number | None |
| PubChem CID | 131750926 |
| Formula | C36H58O29P2 |
| IUPAC Name | 6-[6-[6-(acetyloxymethyl)-2-[3-[3,4-dihydroxy-6-(hydroxymethyl)-5-phosphanyloxyoxan-2-yl]oxy-5-hydroxy-2-(hydroxymethyl)-6-(phosphanylmethyl)oxan-4-yl]oxy-4,5-dihydroxyoxan-3-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-7,8-dihydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carboxylic acid |
| InChI Key | KCOUXTVJDWNYJS-UHFFFAOYSA-N |
| InChI | InChI=1S/C36H58O29P2/c1-8(39)53-5-11-14(40)16(42)28(34(57-11)61-26-15(41)13(7-66)55-10(4-38)25(26)59-31-21(47)18(44)24(65-67)9(3-37)56-31)62-33-22(48)19(45)27(29(63-33)30(49)50)60-32-20(46)17(43)23-12(58-32)6-54-36(2,64-23)35(51)52/h9-29,31-34,37-38,40-48H,3-7,66-67H2,1-2H3,(H,49,50)(H,51,52) |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)OP)O)O)CO)CP)O)OC4C(C(C(C(O4)C(=O)O)OC5C(C(C6C(O5)COC(O6)(C)C(=O)O)O)O)O)O)O)O |
| Isomeric SMILES | CC(=O)OCC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)OP)O)O)CO)CP)O)OC4C(C(C(C(O4)C(=O)O)OC5C(C(C6C(O5)COC(O6)(C)C(=O)O)O)O)O)O)O)O |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Thickening |
| Molecular Synonyms |
Corn sugar gum
E415
XC Polymer
Gum xanthan
Biozan R
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 1016.8 |
| Hydrogen Bond Donor Count | 13 |
| Hydrogen Bond Acceptor Count | 29 |
| Rotatable Bond Count | 17 |
| Complexity | 1670 |
| Monoisotopic Mass | 1016.25389984 |
| Exact Mass | 1016.25389984 |
| XLogP | -9.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 67 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 26 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.6265 |
| Human Intestinal Absorption | HIA- | 0.9502 |
| Caco-2 Permeability | Caco2- | 0.8110 |
| P-glycoprotein Substrate | Substrate | 0.6546 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7010 |
| Non-inhibitor | 0.9596 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8783 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7221 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8311 |
| CYP450 2D6 Substrate | Non-substrate | 0.8499 |
| CYP450 3A4 Substrate | Substrate | 0.5115 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8910 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9262 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9317 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9136 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9276 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9688 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9698 |
| Non-inhibitor | 0.6740 | |
| AMES Toxicity | Non AMES toxic | 0.5466 |
| Carcinogens | Non-carcinogens | 0.9307 |
| Fish Toxicity | High FHMT | 0.7954 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9155 |
| Honey Bee Toxicity | High HBT | 0.7180 |
| Biodegradation | Not ready biodegradable | 0.9749 |
| Acute Oral Toxicity | III | 0.4765 |
| Carcinogenicity (Three-class) | Non-required | 0.7254 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.3629 | LogS |
| Caco-2 Permeability | -0.9554 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.7268 | LD50, mol/kg |
| Fish Toxicity | 1.6683 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1931 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0012 |
| Food Image | ![]() |
| Food Name | Pastry |
| Food Chinese Name | 糕点 |
| Food Type | Processed food |
| References | List of food additives that may be easily abused in food (first batch) |
References
| Title | DOI/PubMed/ISSN |
|---|---|
| Rapid and non-invasive detection and imaging of the hydrocolloid-injected prawns with low-field NMR and MRI. | 29037672 |
| List of food additives that may be easily abused in food (first batch) |
