Procaterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0178 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Procaterol |
| Molecular Chinese Name | 丙卡特罗 |
| 2D Structure | |
| CAS Number | 72332-33-3 |
| PubChem CID | 4916 |
| Formula | C16H22N2O3 |
| IUPAC Name | 8-hydroxy-5-[1-hydroxy-2-(propan-2-ylamino)butyl]-1H-quinolin-2-one |
| InChI Key | FKNXQNWAXFXVNW-UHFFFAOYSA-N |
| InChI | InChI=1S/C16H22N2O3/c1-4-12(17-9(2)3)16(21)11-5-7-13(19)15-10(11)6-8-14(20)18-15/h5-9,12,16-17,19,21H,4H2,1-3H3,(H,18,20) |
| Canonical SMILES | CCC(C(C1=C2C=CC(=O)NC2=C(C=C1)O)O)NC(C)C |
| Isomeric SMILES | CCC(C(C1=C2C=CC(=O)NC2=C(C=C1)O)O)NC(C)C |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
PROCATEROL
72332-33-3
60443-17-6
NSC308904
Meptin
Procaterolum [Latin]
Procaterol [INN:BAN]
OPC-2009
Procaterolum [INN-Latin]
Procaterolo [DCIT]
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:50 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 290.36 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Complexity | 397 |
| Monoisotopic Mass | 290.16304258 |
| Exact Mass | 290.16304258 |
| XLogP | 1.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5966 |
| Human Intestinal Absorption | HIA+ | 0.9964 |
| Caco-2 Permeability | Caco2- | 0.6522 |
| P-glycoprotein Substrate | Substrate | 0.7018 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8943 |
| Non-inhibitor | 0.9204 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9311 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7695 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8105 |
| CYP450 2D6 Substrate | Non-substrate | 0.6879 |
| CYP450 3A4 Substrate | Substrate | 0.5942 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.5380 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.8949 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8986 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.8774 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8309 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6783 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9921 |
| Non-inhibitor | 0.6841 | |
| AMES Toxicity | Non AMES toxic | 0.8558 |
| Carcinogens | Non-carcinogens | 0.9066 |
| Fish Toxicity | Low FHMT | 0.5673 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9768 |
| Honey Bee Toxicity | Low HBT | 0.6380 |
| Biodegradation | Not ready biodegradable | 0.9889 |
| Acute Oral Toxicity | III | 0.6358 |
| Carcinogenicity (Three-class) | Non-required | 0.6513 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.5846 | LogS |
| Caco-2 Permeability | 0.4513 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.4772 | LD50, mol/kg |
| Fish Toxicity | 1.6848 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.2711 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
