Olodaterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0179 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Olodaterol |
| Molecular Chinese Name | 奥达特罗 |
| 2D Structure | |
| CAS Number | 868049-49-4 |
| PubChem CID | 11504295 |
| Formula | C21H26N2O5 |
| IUPAC Name | 6-hydroxy-8-[(1R)-1-hydroxy-2-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]ethyl]-4H-1,4-benzoxazin-3-one |
| InChI Key | COUYJEVMBVSIHV-SFHVURJKSA-N |
| InChI | InChI=1S/C21H26N2O5/c1-21(2,10-13-4-6-15(27-3)7-5-13)22-11-18(25)16-8-14(24)9-17-20(16)28-12-19(26)23-17/h4-9,18,22,24-25H,10-12H2,1-3H3,(H,23,26)/t18-/m0/s1 |
| Canonical SMILES | CC(C)(CC1=CC=C(C=C1)OC)NCC(C2=C3C(=CC(=C2)O)NC(=O)CO3)O |
| Isomeric SMILES | CC(C)(CC1=CC=C(C=C1)OC)NC[C@@H](C2=C3C(=CC(=C2)O)NC(=O)CO3)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
OLODATEROL
868049-49-4
Striverdi Respimat
BI-1744
UNII-VD2YSN1AFD
BI 1744
Olodaterol Free Base
VD2YSN1AFD
Striverdi
BI 1744(Olodaterol;Striverdi Respimat)
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:50 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 386.4 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 7 |
| Complexity | 521 |
| Monoisotopic Mass | 386.18417195 |
| Exact Mass | 386.18417195 |
| XLogP | 1.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 28 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9154 |
| Human Intestinal Absorption | HIA+ | 0.5156 |
| Caco-2 Permeability | Caco2- | 0.7297 |
| P-glycoprotein Substrate | Substrate | 0.9290 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7670 |
| Non-inhibitor | 0.9746 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9152 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4802 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8110 |
| CYP450 2D6 Substrate | Non-substrate | 0.6697 |
| CYP450 3A4 Substrate | Substrate | 0.6450 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8074 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8761 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8110 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8286 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9543 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8872 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9955 |
| Non-inhibitor | 0.7304 | |
| AMES Toxicity | Non AMES toxic | 0.6954 |
| Carcinogens | Non-carcinogens | 0.8952 |
| Fish Toxicity | High FHMT | 0.7333 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9816 |
| Honey Bee Toxicity | Low HBT | 0.6476 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.7078 |
| Carcinogenicity (Three-class) | Non-required | 0.6454 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.9890 | LogS |
| Caco-2 Permeability | 0.3736 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.4996 | LD50, mol/kg |
| Fish Toxicity | 1.2593 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4637 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
