Indacaterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0181 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Indacaterol |
| Molecular Chinese Name | 茚达特罗 |
| 2D Structure | |
| CAS Number | 312753-06-3 |
| PubChem CID | 6918554 |
| Formula | C24H28N2O3 |
| IUPAC Name | 5-[(1R)-2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
| InChI Key | QZZUEBNBZAPZLX-QFIPXVFZSA-N |
| InChI | InChI=1S/C24H28N2O3/c1-3-14-9-16-11-18(12-17(16)10-15(14)4-2)25-13-22(28)19-5-7-21(27)24-20(19)6-8-23(29)26-24/h5-10,18,22,25,27-28H,3-4,11-13H2,1-2H3,(H,26,29)/t22-/m0/s1 |
| Canonical SMILES | CCC1=C(C=C2CC(CC2=C1)NCC(C3=C4C=CC(=O)NC4=C(C=C3)O)O)CC |
| Isomeric SMILES | CCC1=C(C=C2CC(CC2=C1)NC[C@@H](C3=C4C=CC(=O)NC4=C(C=C3)O)O)CC |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Indacaterol
312753-06-3
QAB149
Arcapta
Onbrez
QAB-149
QAB 149
753498-25-8
CHEMBL1095777
UNII-8OR09251MQ
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:51 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 392.5 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 6 |
| Complexity | 589 |
| Monoisotopic Mass | 392.20999277 |
| Exact Mass | 392.20999277 |
| XLogP | 3.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 29 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5000 |
| Human Intestinal Absorption | HIA+ | 0.9963 |
| Caco-2 Permeability | Caco2- | 0.6288 |
| P-glycoprotein Substrate | Substrate | 0.6953 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9284 |
| Non-inhibitor | 0.9178 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8838 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7774 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8148 |
| CYP450 2D6 Substrate | Non-substrate | 0.6907 |
| CYP450 3A4 Substrate | Substrate | 0.5896 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.5530 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.5600 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8547 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5581 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.6546 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5888 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9657 |
| Inhibitor | 0.6406 | |
| AMES Toxicity | Non AMES toxic | 0.7577 |
| Carcinogens | Non-carcinogens | 0.8559 |
| Fish Toxicity | High FHMT | 0.5844 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9338 |
| Honey Bee Toxicity | Low HBT | 0.7847 |
| Biodegradation | Not ready biodegradable | 0.9856 |
| Acute Oral Toxicity | III | 0.6110 |
| Carcinogenicity (Three-class) | Non-required | 0.6497 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.3928 | LogS |
| Caco-2 Permeability | 0.4184 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.6531 | LD50, mol/kg |
| Fish Toxicity | 1.3680 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.3118 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
