Vilanterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0182 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Vilanterol |
| Molecular Chinese Name | 维兰特罗 |
| 2D Structure | |
| CAS Number | 503068-34-6 |
| PubChem CID | 10184665 |
| Formula | C24H33Cl2NO5 |
| IUPAC Name | 4-[(1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| InChI Key | DAFYYTQWSAWIGS-DEOSSOPVSA-N |
| InChI | InChI=1S/C24H33Cl2NO5/c25-21-6-5-7-22(26)20(21)17-32-13-12-31-11-4-2-1-3-10-27-15-24(30)18-8-9-23(29)19(14-18)16-28/h5-9,14,24,27-30H,1-4,10-13,15-17H2/t24-/m0/s1 |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)COCCOCCCCCCNCC(C2=CC(=C(C=C2)O)CO)O)Cl |
| Isomeric SMILES | C1=CC(=C(C(=C1)Cl)COCCOCCCCCCNC[C@@H](C2=CC(=C(C=C2)O)CO)O)Cl |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Vilanterol
503068-34-6
GW642444x
UNII-028LZY775B
GW-642444x
CHEBI:75037
028LZY775B
GW 642444X
4-[(1R)-2-[(6-{2-[(2,6-dichlorophenyl)methoxy]ethoxy}hexyl)amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol
4-((1R)-2-((6-(2-((2,6-dichlorophenyl)methoxy)ethoxy)hexyl)amino)-1-hydroxyethyl)-2-(hydroxymethyl)phenol
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:51 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 486.4 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 16 |
| Complexity | 466 |
| Monoisotopic Mass | 485.1735786 |
| Exact Mass | 485.1735786 |
| XLogP | 3.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 32 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.6850 |
| Human Intestinal Absorption | HIA+ | 0.8475 |
| Caco-2 Permeability | Caco2- | 0.6359 |
| P-glycoprotein Substrate | Substrate | 0.7778 |
| P-glycoprotein Inhibitor | Inhibitor | 0.6270 |
| Inhibitor | 0.8374 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.6452 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7076 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8148 |
| CYP450 2D6 Substrate | Non-substrate | 0.8230 |
| CYP450 3A4 Substrate | Non-substrate | 0.5514 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.9192 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8389 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.7935 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5827 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.6603 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6341 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Strong inhibitor | 0.6548 |
| Inhibitor | 0.7995 | |
| AMES Toxicity | Non AMES toxic | 0.7312 |
| Carcinogens | Non-carcinogens | 0.9178 |
| Fish Toxicity | High FHMT | 0.9381 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9949 |
| Honey Bee Toxicity | Low HBT | 0.6323 |
| Biodegradation | Not ready biodegradable | 0.8990 |
| Acute Oral Toxicity | III | 0.6479 |
| Carcinogenicity (Three-class) | Non-required | 0.7308 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.2643 | LogS |
| Caco-2 Permeability | 0.2872 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.2773 | LD50, mol/kg |
| Fish Toxicity | 1.3407 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5207 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
