Hexoprenaline
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0183 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Hexoprenaline |
| Molecular Chinese Name | 海索那林 |
| 2D Structure | |
| CAS Number | 3215-70-1 |
| PubChem CID | 3609 |
| Formula | C22H32N2O6 |
| IUPAC Name | 4-[2-[6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]benzene-1,2-diol |
| InChI Key | OXLZNBCNGJWPRV-UHFFFAOYSA-N |
| InChI | InChI=1S/C22H32N2O6/c25-17-7-5-15(11-19(17)27)21(29)13-23-9-3-1-2-4-10-24-14-22(30)16-6-8-18(26)20(28)12-16/h5-8,11-12,21-30H,1-4,9-10,13-14H2 |
| Canonical SMILES | C1=CC(=C(C=C1C(CNCCCCCCNCC(C2=CC(=C(C=C2)O)O)O)O)O)O |
| Isomeric SMILES | C1=CC(=C(C=C1C(CNCCCCCCNCC(C2=CC(=C(C=C2)O)O)O)O)O)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
HEXOPRENALINE
3215-70-1
Esoprenalina [DCIT]
Hexoprenaline [INN:BAN]
Hexoprenalinum [INN-Latin]
Hexoprenalino [INN-Spanish]
Gynipral
C22H32N2O6
Ginipral
Ipradol
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:51 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 420.5 |
| Hydrogen Bond Donor Count | 8 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 13 |
| Complexity | 417 |
| Monoisotopic Mass | 420.22603676 |
| Exact Mass | 420.22603676 |
| XLogP | 1.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 30 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9155 |
| Human Intestinal Absorption | HIA+ | 0.8902 |
| Caco-2 Permeability | Caco2- | 0.7278 |
| P-glycoprotein Substrate | Substrate | 0.7928 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8376 |
| Non-inhibitor | 0.5813 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.6701 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8395 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7985 |
| CYP450 2D6 Substrate | Non-substrate | 0.7830 |
| CYP450 3A4 Substrate | Non-substrate | 0.6214 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7502 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9260 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8092 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9280 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7863 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9393 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Strong inhibitor | 0.5412 |
| Inhibitor | 0.7675 | |
| AMES Toxicity | Non AMES toxic | 0.7534 |
| Carcinogens | Non-carcinogens | 0.9346 |
| Fish Toxicity | High FHMT | 0.8601 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9338 |
| Honey Bee Toxicity | Low HBT | 0.6966 |
| Biodegradation | Not ready biodegradable | 0.6718 |
| Acute Oral Toxicity | III | 0.6717 |
| Carcinogenicity (Three-class) | Non-required | 0.7667 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.5297 | LogS |
| Caco-2 Permeability | 0.2189 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.0680 | LD50, mol/kg |
| Fish Toxicity | 1.8328 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.0056 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Dopexamine |
ToxCast & Tox21 Chemicals |
Link |
