Clenhexerol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0187 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Clenhexerol |
| Molecular Chinese Name | - |
| 2D Structure | |
| CAS Number | 78982-88-4 |
| PubChem CID | 53639498 |
| Formula | C14H22Cl2N2O |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-(hexylamino)ethanol |
| InChI Key | OIJJTCCRNKYZHW-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H22Cl2N2O/c1-2-3-4-5-6-18-9-13(19)10-7-11(15)14(17)12(16)8-10/h7-8,13,18-19H,2-6,9,17H2,1H3 |
| Canonical SMILES | CCCCCCNCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
| Isomeric SMILES | CCCCCCNCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
78982-88-4
DTXSID20705585
Clenhexerol, VETRANAL(TM), analytical standard
1-(4-Amino-3,5-dichlorophenyl)-2-(hexylamino)ethan-1-ol
1-(4-Amino-3,5-dichloro-phenyl)-2-hexylaminoethanol
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:58 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 305.2 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 8 |
| Complexity | 232 |
| Monoisotopic Mass | 304.1109187 |
| Exact Mass | 304.1109187 |
| XLogP | 3.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8249 |
| Human Intestinal Absorption | HIA+ | 0.9865 |
| Caco-2 Permeability | Caco2+ | 0.5427 |
| P-glycoprotein Substrate | Substrate | 0.7850 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8718 |
| Non-inhibitor | 0.8908 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7656 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.5406 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8298 |
| CYP450 2D6 Substrate | Non-substrate | 0.6484 |
| CYP450 3A4 Substrate | Non-substrate | 0.6365 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.6661 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8409 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.5149 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7028 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9032 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8421 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.5497 |
| Inhibitor | 0.6058 | |
| AMES Toxicity | Non AMES toxic | 0.6725 |
| Carcinogens | Non-carcinogens | 0.7742 |
| Fish Toxicity | High FHMT | 0.9447 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9967 |
| Honey Bee Toxicity | Low HBT | 0.8739 |
| Biodegradation | Not ready biodegradable | 0.9715 |
| Acute Oral Toxicity | III | 0.5630 |
| Carcinogenicity (Three-class) | Non-required | 0.6078 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.0096 | LogS |
| Caco-2 Permeability | 1.0905 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.4623 | LD50, mol/kg |
| Fish Toxicity | 0.9525 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4436 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Clenbuterol |
DrugBank, CAC Veterinary Drug, National Health Commission of the People's Republic of China, OpenFoodTox, ToxCast & Tox21 Chemicals |
Link |
||
Clenbuterol Hydrochloride |
National Health Commission of the People's Republic of China |
Link |
||
Clenproperol |
FRCD |
Link |
