Clenpenterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0188 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Clenpenterol |
| Molecular Chinese Name | 克仑潘特 |
| 2D Structure | |
| CAS Number | 38339-21-8 |
| PubChem CID | 170033 |
| Formula | C13H20Cl2N2O |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol |
| InChI Key | QVBOTMGSBYXVJQ-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H20Cl2N2O/c1-4-13(2,3)17-7-11(18)8-5-9(14)12(16)10(15)6-8/h5-6,11,17-18H,4,7,16H2,1-3H3 |
| Canonical SMILES | CCC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
| Isomeric SMILES | CCC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
BRN 2847584
38339-21-8
4-Amino-3,5-dichloro-alpha-(((1-dimethylpropyl)amino)methyl)benzenemethanol
AC1Q3LZM
1-(4-amino-3,5-dichlorophenyl)-2-[(2-methylbutan-2-yl)amino]ethanol
AC1L54V0
CTK1C4433
LS-30604
1-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol
Benzenemethanol, 4-amino-3,5-dichloro-alpha-(((1,1-dimethylpropyl)amino)methyl)-
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 11:58 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 291.21 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Complexity | 251 |
| Monoisotopic Mass | 290.0952687 |
| Exact Mass | 290.0952687 |
| XLogP | 2.7 |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8420 |
| Human Intestinal Absorption | HIA+ | 0.9854 |
| Caco-2 Permeability | Caco2+ | 0.5054 |
| P-glycoprotein Substrate | Substrate | 0.7264 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8658 |
| Non-inhibitor | 0.9590 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8993 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.4686 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8462 |
| CYP450 2D6 Substrate | Non-substrate | 0.6618 |
| CYP450 3A4 Substrate | Non-substrate | 0.5273 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7579 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8418 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7460 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8082 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7463 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6425 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9661 |
| Non-inhibitor | 0.5872 | |
| AMES Toxicity | Non AMES toxic | 0.8371 |
| Carcinogens | Carcinogens | 0.5253 |
| Fish Toxicity | High FHMT | 0.9425 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9981 |
| Honey Bee Toxicity | Low HBT | 0.8171 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.5342 |
| Carcinogenicity (Three-class) | Non-required | 0.5884 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.9388 | LogS |
| Caco-2 Permeability | 0.9080 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.7261 | LD50, mol/kg |
| Fish Toxicity | 1.2300 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5023 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
