Brombuterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0195 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Brombuterol |
| Molecular Chinese Name | 溴布特罗 |
| 2D Structure | |
| CAS Number | 41937-02-4 |
| PubChem CID | 3084849 |
| Formula | C12H18Br2N2O |
| IUPAC Name | 1-(4-amino-3,5-dibromophenyl)-2-(tert-butylamino)ethanol |
| InChI Key | PLFUBWPEUSILSL-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H18Br2N2O/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7/h4-5,10,16-17H,6,15H2,1-3H3 |
| Canonical SMILES | CC(C)(C)NCC(C1=CC(=C(C(=C1)Br)N)Br)O |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=C(C(=C1)Br)N)Br)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Brombuterol
41937-02-4
Bromobuterol
AC1MJ3D4
Oprea1_705029
SCHEMBL10614285
AKOS015888358
I01-10345
1-(4-Amino-3,5-dibromo-phenyl)-2-tert-butylamino-ethanol
1-(4-amino-3,5-dibromophenyl)-2-(tert-butylamino)ethanol
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 13:22 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 366.09 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Complexity | 233 |
| Monoisotopic Mass | 363.97859 |
| Exact Mass | 365.97654 |
| XLogP | 2.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8241 |
| Human Intestinal Absorption | HIA+ | 0.9274 |
| Caco-2 Permeability | Caco2+ | 0.5154 |
| P-glycoprotein Substrate | Substrate | 0.5713 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8478 |
| Non-inhibitor | 0.9445 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9041 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5435 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8451 |
| CYP450 2D6 Substrate | Non-substrate | 0.6953 |
| CYP450 3A4 Substrate | Non-substrate | 0.6210 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8433 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8261 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8861 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8753 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8822 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5534 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9807 |
| Non-inhibitor | 0.8349 | |
| AMES Toxicity | Non AMES toxic | 0.8725 |
| Carcinogens | Non-carcinogens | 0.5823 |
| Fish Toxicity | High FHMT | 0.8689 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9973 |
| Honey Bee Toxicity | Low HBT | 0.7587 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.6017 |
| Carcinogenicity (Three-class) | Non-required | 0.5282 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.8562 | LogS |
| Caco-2 Permeability | 0.9745 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.5583 | LD50, mol/kg |
| Fish Toxicity | 1.3789 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.6981 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
