Mapenterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0196 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Mapenterol |
| Molecular Chinese Name | 马喷特罗 |
| 2D Structure | |
| CAS Number | 54238-51-6 |
| PubChem CID | 13355612 |
| Formula | C14H21Cl2F3N2O |
| IUPAC Name | 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride |
| InChI Key | LWJSGOMCMMDPEN-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H20ClF3N2O.ClH/c1-4-13(2,3)20-7-11(21)8-5-9(14(16,17)18)12(19)10(15)6-8;/h5-6,11,20-21H,4,7,19H2,1-3H3;1H |
| Canonical SMILES | CCC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)C(F)(F)F)O.Cl |
| Isomeric SMILES | CCC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)C(F)(F)F)O.Cl |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
54238-51-6
SCHEMBL11054918
CTK8E3025
DTXSID60538091
LWJSGOMCMMDPEN-UHFFFAOYSA-N
AKOS015888382
TR-019188
FT-0670951
Mapenterol hydrochloride
1-(4-Amino-3-chloro-5-trifluoromethylphenyl)-2-(1,1-dimethylpropylamino)ethanol hydrochloride
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 13:22 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 361.2 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Complexity | 339 |
| Monoisotopic Mass | 360.0983032 |
| Exact Mass | 360.0983032 |
| Formal Charge | 0 |
| Heavy Atom Count | 22 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 2 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8887 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2- | 0.5077 |
| P-glycoprotein Substrate | Substrate | 0.7155 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7725 |
| Non-inhibitor | 0.9523 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9100 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5452 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8592 |
| CYP450 2D6 Substrate | Non-substrate | 0.6658 |
| CYP450 3A4 Substrate | Non-substrate | 0.5331 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7164 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8023 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7499 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7367 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7083 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5906 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9265 |
| Non-inhibitor | 0.5261 | |
| AMES Toxicity | Non AMES toxic | 0.8502 |
| Carcinogens | Carcinogens | 0.5127 |
| Fish Toxicity | High FHMT | 0.9661 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9990 |
| Honey Bee Toxicity | Low HBT | 0.7854 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.5755 |
| Carcinogenicity (Three-class) | Non-required | 0.5878 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.2513 | LogS |
| Caco-2 Permeability | 0.9442 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.7543 | LD50, mol/kg |
| Fish Toxicity | 1.2230 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4660 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Mabuterol |
National Health Commission of the People's Republic of China |
Link |
