Mabuterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0197 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Mabuterol |
| Molecular Chinese Name | 马布特罗 |
| 2D Structure | |
| CAS Number | 56341-08-3 |
| PubChem CID | 3995 |
| Formula | C13H18ClF3N2O |
| IUPAC Name | 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanol |
| InChI Key | JSJCTEKTBOKRST-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H18ClF3N2O/c1-12(2,3)19-6-10(20)7-4-8(13(15,16)17)11(18)9(14)5-7/h4-5,10,19-20H,6,18H2,1-3H3 |
| Canonical SMILES | CC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)C(F)(F)F)O |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)C(F)(F)F)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Mabuterol
56341-08-3
Mabuterol [INN]
AMBUTEROL
PB 868Cl
Mabuterolum [INN-Latin]
C13H18ClF3N2O
CCRIS 5288
Mabuterol HCl
1-(4-Amino-3-chloro-5-(trifluoromethyl)phenyl)-2-(tert-butylamino)ethanol
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 13:23 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 310.74 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 4 |
| Complexity | 320 |
| Monoisotopic Mass | 310.1059754 |
| Exact Mass | 310.1059754 |
| XLogP | 2.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 20 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9078 |
| Human Intestinal Absorption | HIA+ | 0.9912 |
| Caco-2 Permeability | Caco2+ | 0.5183 |
| P-glycoprotein Substrate | Substrate | 0.5455 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8058 |
| Non-inhibitor | 0.9526 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9150 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6900 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8293 |
| CYP450 2D6 Substrate | Non-substrate | 0.6922 |
| CYP450 3A4 Substrate | Non-substrate | 0.5840 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8601 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8651 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8998 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8411 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8252 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5087 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9354 |
| Non-inhibitor | 0.8067 | |
| AMES Toxicity | Non AMES toxic | 0.9133 |
| Carcinogens | Non-carcinogens | 0.5355 |
| Fish Toxicity | High FHMT | 0.9270 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9974 |
| Honey Bee Toxicity | Low HBT | 0.7389 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.6687 |
| Carcinogenicity (Three-class) | Non-required | 0.5738 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.2158 | LogS |
| Caco-2 Permeability | 1.0642 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.6765 | LD50, mol/kg |
| Fish Toxicity | 1.2141 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4533 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
