Clorprenaline
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0199 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Clorprenaline |
| Molecular Chinese Name | 氯丙那林 |
| 2D Structure | |
| CAS Number | 3811-25-4 |
| PubChem CID | 2810 |
| Formula | C11H16ClNO |
| IUPAC Name | 1-(2-chlorophenyl)-2-(propan-2-ylamino)ethanol |
| InChI Key | SSMSBSWKLKKXGG-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H16ClNO/c1-8(2)13-7-11(14)9-5-3-4-6-10(9)12/h3-6,8,11,13-14H,7H2,1-2H3 |
| Canonical SMILES | CC(C)NCC(C1=CC=CC=C1Cl)O |
| Isomeric SMILES | CC(C)NCC(C1=CC=CC=C1Cl)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
CLORPRENALINE
3811-25-4
Clorprenalina
1-(2-chlorophenyl)-2-(propan-2-ylamino)ethanol
Clorprenalinum
Isoprophenamin
1-(2-Chlorophenyl)-2-(isopropylamino)ethanol
NCGC00167538-01
Isoprofenamine
Benzenemethanol, 2-chloro-.alpha.-[[(1-methylethyl)amino]methyl]-
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 13:23 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 213.7 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Complexity | 163 |
| Monoisotopic Mass | 213.0920418 |
| Exact Mass | 213.0920418 |
| XLogP | 2.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 14 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8756 |
| Human Intestinal Absorption | HIA+ | 0.9910 |
| Caco-2 Permeability | Caco2+ | 0.6516 |
| P-glycoprotein Substrate | Non-substrate | 0.5108 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8869 |
| Non-inhibitor | 0.9760 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8448 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6801 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7848 |
| CYP450 2D6 Substrate | Non-substrate | 0.6253 |
| CYP450 3A4 Substrate | Non-substrate | 0.6302 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.5000 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9094 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.5128 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8440 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8737 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7319 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9024 |
| Non-inhibitor | 0.7292 | |
| AMES Toxicity | Non AMES toxic | 0.8842 |
| Carcinogens | Non-carcinogens | 0.7367 |
| Fish Toxicity | High FHMT | 0.9404 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9936 |
| Honey Bee Toxicity | Low HBT | 0.6798 |
| Biodegradation | Not ready biodegradable | 0.9740 |
| Acute Oral Toxicity | III | 0.6754 |
| Carcinogenicity (Three-class) | Non-required | 0.7261 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.4022 | LogS |
| Caco-2 Permeability | 1.2110 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.7064 | LD50, mol/kg |
| Fish Toxicity | 1.4099 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5559 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Tulobuterol |
, National Health Commission of the People's Republic of China |
Link |
