Alprenolol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0206 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Alprenolol |
| Molecular Chinese Name | 阿普洛尔 |
| 2D Structure | |
| CAS Number | 13655-52-2 |
| PubChem CID | 2119 |
| Formula | C15H23NO2 |
| IUPAC Name | 1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol |
| InChI Key | PAZJSJFMUHDSTF-UHFFFAOYSA-N |
| InChI | InChI=1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3 |
| Canonical SMILES | CC(C)NCC(COC1=CC=CC=C1CC=C)O |
| Isomeric SMILES | CC(C)NCC(COC1=CC=CC=C1CC=C)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Alfeprol
Alpheprol
Alprenololum
13655-52-2
Alfeprol [Russian]
Yobir
Dl-Alprenolol
Alprenolol [INN:BAN]
Alprenolol
Alprenololum [INN-Latin]
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 13:25 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 249.35 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 8 |
| Complexity | 231 |
| Monoisotopic Mass | 249.17287899 |
| Exact Mass | 249.17287899 |
| XLogP | 3.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9394 |
| Human Intestinal Absorption | HIA+ | 0.9831 |
| Caco-2 Permeability | Caco2+ | 0.8866 |
| P-glycoprotein Substrate | Substrate | 0.6064 |
| P-glycoprotein Inhibitor | Inhibitor | 0.5066 |
| Non-inhibitor | 0.8382 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8305 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8836 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8240 |
| CYP450 2D6 Substrate | Substrate | 0.8820 |
| CYP450 3A4 Substrate | Non-substrate | 0.7469 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.9106 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.8931 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8839 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8933 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8664 |
| Non-inhibitor | 0.6946 | |
| AMES Toxicity | Non AMES toxic | 0.9133 |
| Carcinogens | Non-carcinogens | 0.9106 |
| Fish Toxicity | High FHMT | 0.9976 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9844 |
| Honey Bee Toxicity | High HBT | 0.5234 |
| Biodegradation | Not ready biodegradable | 0.9646 |
| Acute Oral Toxicity | III | 0.7047 |
| Carcinogenicity (Three-class) | Non-required | 0.7445 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.0797 | LogS |
| Caco-2 Permeability | 1.5244 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.5069 | LD50, mol/kg |
| Fish Toxicity | 1.4320 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.0199 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
