Penbutolol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0208 |
| Substance Name | Beta stimulants |
| Substance Chinese Name | Β-兴奋剂类药物 |
| Molecular Name | Penbutolol |
| Molecular Chinese Name | 喷布洛尔 |
| 2D Structure | |
| CAS Number | None |
| PubChem CID | 37464 |
| Formula | C18H29NO2 |
| IUPAC Name | (2S)-1-(tert-butylamino)-3-(2-cyclopentylphenoxy)propan-2-ol |
| InChI Key | KQXKVJAGOJTNJS-HNNXBMFYSA-N |
| InChI | InChI=1S/C18H29NO2/c1-18(2,3)19-12-15(20)13-21-17-11-7-6-10-16(17)14-8-4-5-9-14/h6-7,10-11,14-15,19-20H,4-5,8-9,12-13H2,1-3H3/t15-/m0/s1 |
| Canonical SMILES | CC(C)(C)NCC(COC1=CC=CC=C1C2CCCC2)O |
| Isomeric SMILES | CC(C)(C)NC[C@@H](COC1=CC=CC=C1C2CCCC2)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Increase lean meat percentage |
| Molecular Synonyms |
Penbutolol
Betapressin
Levopenbutol
Levatol
L-Penbutolol
HOE 893d
S(-)-Penbutolol
PENBUTOLOL SULFATE
Penbutololum
(-)-Penbutolol
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 13:35 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 291.4 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 7 |
| Complexity | 294 |
| Monoisotopic Mass | 291.21982918 |
| Exact Mass | 291.21982918 |
| XLogP | 4.2 |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.7470 |
| Human Intestinal Absorption | HIA+ | 0.9935 |
| Caco-2 Permeability | Caco2+ | 0.5961 |
| P-glycoprotein Substrate | Substrate | 0.6827 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7493 |
| Non-inhibitor | 0.7789 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8696 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.9235 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7898 |
| CYP450 2D6 Substrate | Substrate | 0.8919 |
| CYP450 3A4 Substrate | Non-substrate | 0.6339 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.9107 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8899 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.8932 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9026 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8309 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7132 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9436 |
| Non-inhibitor | 0.5704 | |
| AMES Toxicity | Non AMES toxic | 0.8317 |
| Carcinogens | Non-carcinogens | 0.8643 |
| Fish Toxicity | High FHMT | 0.9797 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9787 |
| Honey Bee Toxicity | Low HBT | 0.5169 |
| Biodegradation | Not ready biodegradable | 0.9927 |
| Acute Oral Toxicity | III | 0.7755 |
| Carcinogenicity (Three-class) | Non-required | 0.6212 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.5662 | LogS |
| Caco-2 Permeability | 1.2473 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.3931 | LD50, mol/kg |
| Fish Toxicity | 1.6017 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1084 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Penbutolol sulfate |
ToxCast & Tox21 Chemicals |
Link |
