Methenamine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0215 |
| Substance Name | Methenamine |
| Substance Chinese Name | 乌洛托品 |
| Molecular Name | Methenamine |
| Molecular Chinese Name | 六亚甲基四胺 |
| 2D Structure | |
| CAS Number | 100-97-0 |
| PubChem CID | 4101 |
| Formula | C6H12N4 |
| IUPAC Name | 1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
| InChI Key | VKYKSIONXSXAKP-UHFFFAOYSA-N |
| InChI | InChI=1S/C6H12N4/c1-7-2-9-4-8(1)5-10(3-7)6-9/h1-6H2 |
| Canonical SMILES | C1N2CN3CN1CN(C2)C3 |
| Isomeric SMILES | C1N2CN3CN1CN(C2)C3 |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Antiseptic |
| Molecular Synonyms |
Methenamine
Hexamethylenetetramine
100-97-0
Hexamine
Urotropine
1,3,5,7-Tetraazaadamantane
Aminoform
Methenamin
Urotropin
Hexamethylenamine
|
| Data Uploader | MinQing Cai |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 140.19 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Complexity | 84.8 |
| Monoisotopic Mass | 140.1061964 |
| Exact Mass | 140.1061964 |
| XLogP | 0.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 10 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9471 |
| Human Intestinal Absorption | HIA+ | 0.9512 |
| Caco-2 Permeability | Caco2+ | 0.6422 |
| P-glycoprotein Substrate | Non-substrate | 0.5751 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9010 |
| Non-inhibitor | 0.8233 | |
| Renal Organic Cation Transporter | Inhibitor | 0.5844 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4811 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.9050 |
| CYP450 2D6 Substrate | Non-substrate | 0.5443 |
| CYP450 3A4 Substrate | Non-substrate | 0.7343 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7688 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9102 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9345 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9041 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9119 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5775 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.7993 |
| Non-inhibitor | 0.8231 | |
| AMES Toxicity | AMES toxic | 0.9107 |
| Carcinogens | Non-carcinogens | 0.9039 |
| Fish Toxicity | Low FHMT | 0.8572 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.5443 |
| Honey Bee Toxicity | Low HBT | 0.6625 |
| Biodegradation | Not ready biodegradable | 0.9559 |
| Acute Oral Toxicity | I | 0.7900 |
| Carcinogenicity (Three-class) | Non-required | 0.7096 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -1.9589 | LogS |
| Caco-2 Permeability | 1.4964 | LogPapp, cm/s |
| Rat Acute Toxicity | 3.8831 | LD50, mol/kg |
| Fish Toxicity | 4.5724 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.3642 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0001 |
| Food Image | ![]() |
| Food Name | Dried beancurd stick |
| Food Chinese Name | 腐竹 |
| Food Type | Processed food |
| References | None |
| FADB-China ID | F0081 |
| Food Image | ![]() |
| Food Name | Rice noodle |
| Food Chinese Name | 米线 |
| Food Type | Processed food |
| References | None |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
1,3,5-Triazine, hexahydro-1,3,5-trimethyl- |
HPV EPA Chemicals, ToxCast & Tox21 Chemicals |
Link |
References
| Title | DOI/PubMed/ISSN |
|---|

