Methenamine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0215 | 
| Substance Name | Methenamine | 
| Substance Chinese Name | 乌洛托品 | 
| Molecular Name | Methenamine | 
| Molecular Chinese Name | 六亚甲基四胺 | 
| 2D Structure | |
| CAS Number | 100-97-0 | 
| PubChem CID | 4101 | 
| Formula | C6H12N4 | 
| IUPAC Name | 1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane | 
| InChI Key | VKYKSIONXSXAKP-UHFFFAOYSA-N | 
| InChI | InChI=1S/C6H12N4/c1-7-2-9-4-8(1)5-10(3-7)6-9/h1-6H2 | 
| Canonical SMILES | C1N2CN3CN1CN(C2)C3  | 
| Isomeric SMILES | C1N2CN3CN1CN(C2)C3  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing | 
| Addition Purposes | Antiseptic | 
| Molecular Synonyms | 
        
            Methenamine
        
            Hexamethylenetetramine
        
            100-97-0
        
            Hexamine
        
            Urotropine
        
            1,3,5,7-Tetraazaadamantane
        
            Aminoform
        
            Methenamin
        
            Urotropin
        
            Hexamethylenamine
         | 
| Data Uploader | MinQing Cai | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 140.19 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 4 | 
| Rotatable Bond Count | 0 | 
| Complexity | 84.8 | 
| Monoisotopic Mass | 140.1061964 | 
| Exact Mass | 140.1061964 | 
| XLogP | 0.3 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 10 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9471 | 
| Human Intestinal Absorption | HIA+ | 0.9512 | 
| Caco-2 Permeability | Caco2+ | 0.6422 | 
| P-glycoprotein Substrate | Non-substrate | 0.5751 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9010 | 
| Non-inhibitor | 0.8233 | |
| Renal Organic Cation Transporter | Inhibitor | 0.5844 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4811 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.9050 | 
| CYP450 2D6 Substrate | Non-substrate | 0.5443 | 
| CYP450 3A4 Substrate | Non-substrate | 0.7343 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7688 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9102 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9345 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9041 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9119 | 
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5775 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.7993 | 
| Non-inhibitor | 0.8231 | |
| AMES Toxicity | AMES toxic | 0.9107 | 
| Carcinogens | Non-carcinogens | 0.9039 | 
| Fish Toxicity | Low FHMT | 0.8572 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.5443 | 
| Honey Bee Toxicity | Low HBT | 0.6625 | 
| Biodegradation | Not ready biodegradable | 0.9559 | 
| Acute Oral Toxicity | I | 0.7900 | 
| Carcinogenicity (Three-class) | Non-required | 0.7096 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -1.9589 | LogS | 
| Caco-2 Permeability | 1.4964 | LogPapp, cm/s | 
| Rat Acute Toxicity | 3.8831 | LD50, mol/kg | 
| Fish Toxicity | 4.5724 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.3642 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0001 | 
| Food Image | ![]()  | 
        
| Food Name | Dried beancurd stick | 
| Food Chinese Name | 腐竹 | 
| Food Type | Processed food | 
| References | None | 
| FADB-China ID | F0081 | 
| Food Image | ![]()  | 
        
| Food Name | Rice noodle | 
| Food Chinese Name | 米线 | 
| Food Type | Processed food | 
| References | None | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
1,3,5-Triazine, hexahydro-1,3,5-trimethyl-  | 
            
            
            
            
            HPV EPA Chemicals, ToxCast & Tox21 Chemicals  | 
            Link  | 
        
References
| Title | DOI/PubMed/ISSN | 
|---|

