DCB
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0226 | 
| Substance Name | Fluorescent whitening substance | 
| Substance Chinese Name | 荧光增白物质 | 
| Molecular Name | DCB | 
| Molecular Chinese Name | 荧光增白剂DCB | 
| 2D Structure | |
| CAS Number | None | 
| PubChem CID | 102325648 | 
| Formula | C84H110O6 | 
| IUPAC Name | 2-[12-[4-[4-[(2S)-octan-2-yl]oxyphenyl]phenoxy]dodecoxy]-1-[2-[12-[4-[4-[(2S)-octan-2-yl]oxyphenyl]phenoxy]dodecoxy]naphthalen-1-yl]naphthalene | 
| InChI Key | NYLSTTOOESZEJH-NZTQFBENSA-N | 
| InChI | InChI=1S/C84H110O6/c1-5-7-9-27-37-67(3)89-77-57-47-71(48-58-77)69-43-53-75(54-44-69)85-63-33-23-19-15-11-13-17-21-25-35-65-87-81-61-51-73-39-29-31-41-79(73)83(81)84-80-42-32-30-40-74(80)52-62-82(84)88-66-36-26-22-18-14-12-16-20-24-34-64-86-76-55-45-70(46-56-76)72-49-59-78(60-50-72)90-68(4)38-28-10-8-6-2/h29-32,39-62,67-68H,5-28,33-38,63-66H2,1-4H3/t67-,68-/m0/s1 | 
| Canonical SMILES | CCCCCCC(C)OC1=CC=C(C=C1)C2=CC=C(C=C2)OCCCCCCCCCCCCOC3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)OCCCCCCCCCCCCOC7=CC=C(C=C7)C8=CC=C(C=C8)OC(C)CCCCCC  | 
| Isomeric SMILES | CCCCCC[C@H](C)OC1=CC=C(C=C1)C2=CC=C(C=C2)OCCCCCCCCCCCCOC3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)OCCCCCCCCCCCCOC7=CC=C(C=C7)C8=CC=C(C=C8)O[C@@H](C)CCCCCC  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Circulation | 
| Addition Purposes | Improve color | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:27 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 1215.8 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 6 | 
| Rotatable Bond Count | 47 | 
| Complexity | 1570 | 
| Monoisotopic Mass | 1214.83024126 | 
| Exact Mass | 1214.83024126 | 
| XLogP | 28.5 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 90 | 
| Defined Atom Stereocenter Count | 2 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8848 | 
| Human Intestinal Absorption | HIA+ | 1.0000 | 
| Caco-2 Permeability | Caco2+ | 0.7780 | 
| P-glycoprotein Substrate | Substrate | 0.6424 | 
| P-glycoprotein Inhibitor | Inhibitor | 0.6439 | 
| Inhibitor | 0.7978 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7576 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7987 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8210 | 
| CYP450 2D6 Substrate | Non-substrate | 0.7231 | 
| CYP450 3A4 Substrate | Substrate | 0.6808 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.6409 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6807 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9272 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5186 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.6511 | 
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.7015 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.7130 | 
| Inhibitor | 0.7381 | |
| AMES Toxicity | Non AMES toxic | 0.9189 | 
| Carcinogens | Non-carcinogens | 0.7717 | 
| Fish Toxicity | High FHMT | 0.9965 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9987 | 
| Honey Bee Toxicity | High HBT | 0.7506 | 
| Biodegradation | Not ready biodegradable | 0.9831 | 
| Acute Oral Toxicity | IV | 0.5732 | 
| Carcinogenicity (Three-class) | Non-required | 0.5929 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -6.3221 | LogS | 
| Caco-2 Permeability | 1.1688 | LogPapp, cm/s | 
| Rat Acute Toxicity | 1.8009 | LD50, mol/kg | 
| Fish Toxicity | -0.2112 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 1.9167 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0083 | 
| Food Image | ![]()  | 
        
| Food Name | Agaricus bisporus | 
| Food Chinese Name | 双孢蘑菇 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
| FADB-China ID | F0084 | 
| Food Image | ![]()  | 
        
| Food Name | Enokitake | 
| Food Chinese Name | 金针菇 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
| FADB-China ID | F0085 | 
| Food Image | ![]()  | 
        
| Food Name | Pleurotus nebrodensis | 
| Food Chinese Name | 白灵菇 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
| FADB-China ID | F0086 | 
| Food Image | ![]()  | 
        
| Food Name | Flour | 
| Food Chinese Name | 面粉 | 
| Food Type | Processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 



