Naphthalimide
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0227 | 
| Substance Name | Fluorescent whitening substance | 
| Substance Chinese Name | 荧光增白物质 | 
| Molecular Name | Naphthalimide | 
| Molecular Chinese Name | 萘二甲酰亚胺 | 
| 2D Structure | |
| CAS Number | 81-83-4 | 
| PubChem CID | 66491 | 
| Formula | C12H7NO2 | 
| IUPAC Name | Benzo[de]isoquinoline-1,3-dione | 
| InChI Key | XJHABGPPCLHLLV-UHFFFAOYSA-N | 
| InChI | InChI=1S/C12H7NO2/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13-11/h1-6H,(H,13,14,15) | 
| Canonical SMILES | C1=CC2=C3C(=C1)C(=O)NC(=O)C3=CC=C2  | 
| Isomeric SMILES | C1=CC2=C3C(=C1)C(=O)NC(=O)C3=CC=C2  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Circulation | 
| Addition Purposes | Improve color | 
| Molecular Synonyms | 
        
            1,8-Naphthalimide
        
            81-83-4
        
            Naphthalimide
        
            1H-Benzo[de]isoquinoline-1,3(2H)-dione
        
            1,8-Naphthalenedicarboximide
        
            Benzo[de]isoquinoline-1,3-dione
        
            UNII-GI0TV19GBN
        
            Naphthalene-1,8-dicarboximide
        
            GI0TV19GBN
        
            1H-Benz[de]isoquinoline-1,3(2H)-dione
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:27 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 197.19 | 
| Hydrogen Bond Donor Count | 1 | 
| Hydrogen Bond Acceptor Count | 2 | 
| Rotatable Bond Count | 0 | 
| Complexity | 285 | 
| Monoisotopic Mass | 197.047678469 | 
| Exact Mass | 197.047678469 | 
| XLogP | 1.7 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 15 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9971 | 
| Human Intestinal Absorption | HIA+ | 1.0000 | 
| Caco-2 Permeability | Caco2+ | 0.6392 | 
| P-glycoprotein Substrate | Non-substrate | 0.7649 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9665 | 
| Non-inhibitor | 0.9799 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8585 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5461 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8331 | 
| CYP450 2D6 Substrate | Non-substrate | 0.7612 | 
| CYP450 3A4 Substrate | Non-substrate | 0.6192 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.9324 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9578 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9334 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9322 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9487 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9475 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9736 | 
| Non-inhibitor | 0.9572 | |
| AMES Toxicity | Non AMES toxic | 0.6955 | 
| Carcinogens | Non-carcinogens | 0.9528 | 
| Fish Toxicity | Low FHMT | 0.6137 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.7631 | 
| Honey Bee Toxicity | Low HBT | 0.6093 | 
| Biodegradation | Not ready biodegradable | 0.5225 | 
| Acute Oral Toxicity | III | 0.6974 | 
| Carcinogenicity (Three-class) | Non-required | 0.5754 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -2.9618 | LogS | 
| Caco-2 Permeability | 1.5683 | LogPapp, cm/s | 
| Rat Acute Toxicity | 1.9732 | LD50, mol/kg | 
| Fish Toxicity | 1.7710 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.1006 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0083 | 
| Food Image | ![]()  | 
        
| Food Name | Agaricus bisporus | 
| Food Chinese Name | 双孢蘑菇 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
| FADB-China ID | F0084 | 
| Food Image | ![]()  | 
        
| Food Name | Enokitake | 
| Food Chinese Name | 金针菇 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
| FADB-China ID | F0085 | 
| Food Image | ![]()  | 
        
| Food Name | Pleurotus nebrodensis | 
| Food Chinese Name | 白灵菇 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
| FADB-China ID | F0086 | 
| Food Image | ![]()  | 
        
| Food Name | Flour | 
| Food Chinese Name | 面粉 | 
| Food Type | Processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
6-AMINO-BENZO[DE]ISOQUINOLINE-1,3-DIONE  | 
            
            
            
            
            DrugBank  | 
            Link  | 
        



