Herniarin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0233 | 
| Substance Name | Coumarins | 
| Substance Chinese Name | 香豆素类 | 
| Molecular Name | Herniarin | 
| Molecular Chinese Name | 赫尼亚林 | 
| 2D Structure | |
| CAS Number | 531-59-9 | 
| PubChem CID | 10748 | 
| Formula | C10H8O3 | 
| IUPAC Name | 7-methoxychromen-2-one | 
| InChI Key | LIIALPBMIOVAHH-UHFFFAOYSA-N | 
| InChI | InChI=1S/C10H8O3/c1-12-8-4-2-7-3-5-10(11)13-9(7)6-8/h2-6H,1H3 | 
| Canonical SMILES | COC1=CC2=C(C=C1)C=CC(=O)O2  | 
| Isomeric SMILES | COC1=CC2=C(C=C1)C=CC(=O)O2  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Dining | 
| Addition Purposes | Improve flavor | 
| Molecular Synonyms | 
        
            Herniarin
        
            531-59-9
        
            Ayapanin
        
            7-Methoxy-2H-chromen-2-one
        
            Herniarine
        
            Methylumbelliferone
        
            7-Methoxy-2H-1-benzopyran-2-one
        
            7-methoxychromen-2-one
        
            7-Methoxycoumarin
        
            2H-1-BENZOPYRAN-2-ONE, 7-METHOXY-
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 176.17 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 3 | 
| Rotatable Bond Count | 1 | 
| Complexity | 234 | 
| Monoisotopic Mass | 176.047344117 | 
| Exact Mass | 176.047344117 | 
| XLogP | 1.9 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 13 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8985 | 
| Human Intestinal Absorption | HIA+ | 0.9959 | 
| Caco-2 Permeability | Caco2+ | 0.9282 | 
| P-glycoprotein Substrate | Non-substrate | 0.5290 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6281 | 
| Non-inhibitor | 0.6734 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8269 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6150 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7679 | 
| CYP450 2D6 Substrate | Non-substrate | 0.9113 | 
| CYP450 3A4 Substrate | Non-substrate | 0.6552 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.9923 | 
| CYP450 2C9 Inhibitor | Inhibitor | 0.5000 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8988 | 
| CYP450 2C19 Inhibitor | Inhibitor | 0.7471 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8309 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5348 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9159 | 
| Non-inhibitor | 0.9577 | |
| AMES Toxicity | Non AMES toxic | 0.5831 | 
| Carcinogens | Non-carcinogens | 0.9294 | 
| Fish Toxicity | High FHMT | 0.8199 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9751 | 
| Honey Bee Toxicity | High HBT | 0.8550 | 
| Biodegradation | Not ready biodegradable | 0.5970 | 
| Acute Oral Toxicity | III | 0.8038 | 
| Carcinogenicity (Three-class) | Warning | 0.4614 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -3.1339 | LogS | 
| Caco-2 Permeability | 1.2952 | LogPapp, cm/s | 
| Rat Acute Toxicity | 1.6434 | LD50, mol/kg | 
| Fish Toxicity | 0.5233 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.7909 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0092 | 
| Food Image | ![]()  | 
        
| Food Name | Drinks | 
| Food Chinese Name | 饮料 | 
| Food Type | Processed food | 
| References | None | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
7-Hydroxycoumarin  | 
            
            
            
            
            FRCD  | 
            Link  | 
        ||
Umbelliferone  | 
            
            
            
            
            FRCD  | 
            Link  | 
        ||
Scoparone  | 
            
            
            
            
            ToxinDB  | 
            Link  | 
        ||
5,7-Dimethoxy-2H-chromen-2-one  | 
            
            
            
            
            ToxCast & Tox21 Chemicals  | 
            Link  | 
        
References
| Title | DOI/PubMed/ISSN | 
|---|
