Limettin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0235 | 
| Substance Name | Coumarins | 
| Substance Chinese Name | 香豆素类 | 
| Molecular Name | Limettin | 
| Molecular Chinese Name | 白柠檬素 | 
| 2D Structure | |
| CAS Number | 487-06-9 | 
| PubChem CID | 2775 | 
| Formula | C11H10O4 | 
| IUPAC Name | 5,7-dimethoxychromen-2-one | 
| InChI Key | NXJCRELRQHZBQA-UHFFFAOYSA-N | 
| InChI | InChI=1S/C11H10O4/c1-13-7-5-9(14-2)8-3-4-11(12)15-10(8)6-7/h3-6H,1-2H3 | 
| Canonical SMILES | COC1=CC2=C(C=CC(=O)O2)C(=C1)OC  | 
| Isomeric SMILES | COC1=CC2=C(C=CC(=O)O2)C(=C1)OC  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Dining | 
| Addition Purposes | Improve flavor | 
| Molecular Synonyms | 
        
            Citropten
        
            5,7-Dimethoxycoumarin
        
            487-06-9
        
            Limettin
        
            Citroptene
        
            Limetin
        
            Citraptene
        
            5,7-Dimethoxy-2H-chromen-2-one
        
            5,7-dimethoxychromen-2-one
        
            2H-1-Benzopyran-2-one, 5,7-dimethoxy-
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 206.19 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 4 | 
| Rotatable Bond Count | 2 | 
| Complexity | 274 | 
| Monoisotopic Mass | 206.0579088 | 
| Exact Mass | 206.0579088 | 
| XLogP | 1.9 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 15 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8698 | 
| Human Intestinal Absorption | HIA+ | 0.9823 | 
| Caco-2 Permeability | Caco2+ | 0.9221 | 
| P-glycoprotein Substrate | Non-substrate | 0.5133 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6117 | 
| Non-inhibitor | 0.6352 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8542 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5314 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8061 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8956 | 
| CYP450 3A4 Substrate | Non-substrate | 0.5861 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.9692 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.5811 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8248 | 
| CYP450 2C19 Inhibitor | Inhibitor | 0.5383 | 
| CYP450 3A4 Inhibitor | Inhibitor | 0.5703 | 
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5765 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9394 | 
| Non-inhibitor | 0.9522 | |
| AMES Toxicity | AMES toxic | 0.6196 | 
| Carcinogens | Non-carcinogens | 0.9244 | 
| Fish Toxicity | High FHMT | 0.8503 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9719 | 
| Honey Bee Toxicity | High HBT | 0.8686 | 
| Biodegradation | Not ready biodegradable | 0.5285 | 
| Acute Oral Toxicity | III | 0.5457 | 
| Carcinogenicity (Three-class) | Non-required | 0.5640 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -3.3719 | LogS | 
| Caco-2 Permeability | 1.2077 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.2985 | LD50, mol/kg | 
| Fish Toxicity | 0.0111 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.7827 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0092 | 
| Food Image | ![]()  | 
        
| Food Name | Drinks | 
| Food Chinese Name | 饮料 | 
| Food Type | Processed food | 
| References | None | 
References
| Title | DOI/PubMed/ISSN | 
|---|
