Esculentin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0238 | 
| Substance Name | Coumarins | 
| Substance Chinese Name | 香豆素类 | 
| Molecular Name | Esculentin | 
| Molecular Chinese Name | 七叶内酯 | 
| 2D Structure | |
| CAS Number | 131889-89-9 | 
| PubChem CID | 188404 | 
| Formula | C42H68O17 | 
| IUPAC Name | 1-[3-[5-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,11,12,14,16-pentahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,17-decahydrocyclopenta[a]phenanthren-16-yl]ethanone | 
| InChI Key | DPMVYTYRMGJDQQ-UHFFFAOYSA-N | 
| InChI | InChI=1S/C42H68O17/c1-19-29(44)34(53-9)30(45)37(56-19)59-33-21(3)55-28(16-26(33)52-8)58-32-20(2)54-27(15-25(32)51-7)57-24-11-12-38(5)23(14-24)10-13-41(49)35(38)31(46)36(47)39(6)17-40(48,22(4)43)18-42(39,41)50/h10,19-21,24-37,44-50H,11-18H2,1-9H3 | 
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4CCC5(C6C(C(C7(CC(CC7(C6(CC=C5C4)O)O)(C(=O)C)O)C)O)O)C)C)C)O)OC)O  | 
| Isomeric SMILES | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4CCC5(C6C(C(C7(CC(CC7(C6(CC=C5C4)O)O)(C(=O)C)O)C)O)O)C)C)C)O)OC)O  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Dining | 
| Addition Purposes | Improve flavor | 
| Molecular Synonyms | 
        
            Esculentin Steroid
        
            AC1L4MQG
        
            AC1Q5CDV
        
            131889-89-9
        
            A809397
        
            1-[3-[4-methoxy-5-[4-methoxy-5-[4-methoxy-6-methyl-3,5-bis(oxidanyl)oxan-2-yl]oxy-6-methyl-oxan-2-yl]oxy-6-methyl-oxan-2-yl]oxy-10,13-dimethyl-8,11,12,14,16-pentakis(oxidanyl)-1,2,3,4,7,9,11,12,15,17-decahydrocyclopenta[a]phenanthren-16-yl]ethanone
        
            1-[3-[5-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,11,12,14,16-pentahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,17-decahydrocyclopenta[a]phenanthren-16-yl]ethanone
        
            16-acetyl-8,11,12,14,16-pentahydroxyandrost-5-en-3-yl 6-deoxy-3-o-methylhexopyranosyl-(1-
        
            Pregn-5-en-20-one, 3-((O-6-deoxy-3-O-methyl-beta-D-glucopyranosyl-(1-4)-O-2,6-dideoxy-3-O-methyl-beta-D-ribo-hexopyranosyl-(1-4)-2,6-dideoxy-3-O-methyl-beta-D-arabino-hexopyranosyl)oxy)-8,11,12,14,17-pentahydroxy-, (3beta,11alpha,12beta,14beta,17alpha)-
        
            1-[3-[[5-[[5-[(3,5-dihydroxy-4-methoxy-6-methyl-2-oxanyl)oxy]-4-methoxy-6-methyl-2-oxanyl]oxy]-4-methoxy-6-methyl-2-oxanyl]oxy]-8,11,12,14,16-pentahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,17-decahydrocyclopenta[a]phenanthren-16-yl]ethanone
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 845 | 
| Hydrogen Bond Donor Count | 7 | 
| Hydrogen Bond Acceptor Count | 17 | 
| Rotatable Bond Count | 10 | 
| Complexity | 1570 | 
| Monoisotopic Mass | 844.44565073 | 
| Exact Mass | 844.44565073 | 
| XLogP | -1.1 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 59 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 22 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5306 | 
| Human Intestinal Absorption | HIA+ | 0.6796 | 
| Caco-2 Permeability | Caco2- | 0.8237 | 
| P-glycoprotein Substrate | Substrate | 0.8611 | 
| P-glycoprotein Inhibitor | Inhibitor | 0.5223 | 
| Non-inhibitor | 0.7916 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8686 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7157 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8711 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8950 | 
| CYP450 3A4 Substrate | Substrate | 0.7422 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8776 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9159 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9398 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9182 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9305 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9593 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9727 | 
| Non-inhibitor | 0.5849 | |
| AMES Toxicity | Non AMES toxic | 0.9126 | 
| Carcinogens | Non-carcinogens | 0.9750 | 
| Fish Toxicity | High FHMT | 0.9589 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9969 | 
| Honey Bee Toxicity | High HBT | 0.8476 | 
| Biodegradation | Not ready biodegradable | 0.9503 | 
| Acute Oral Toxicity | II | 0.3964 | 
| Carcinogenicity (Three-class) | Non-required | 0.5541 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -4.5843 | LogS | 
| Caco-2 Permeability | 0.2197 | LogPapp, cm/s | 
| Rat Acute Toxicity | 3.0490 | LD50, mol/kg | 
| Fish Toxicity | 0.9594 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.9973 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0092 | 
| Food Image | ![]()  | 
        
| Food Name | Drinks | 
| Food Chinese Name | 饮料 | 
| Food Type | Processed food | 
| References | None | 
References
| Title | DOI/PubMed/ISSN | 
|---|
