Esculentin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0238 |
| Substance Name | Coumarins |
| Substance Chinese Name | 香豆素类 |
| Molecular Name | Esculentin |
| Molecular Chinese Name | 七叶内酯 |
| 2D Structure | |
| CAS Number | 131889-89-9 |
| PubChem CID | 188404 |
| Formula | C42H68O17 |
| IUPAC Name | 1-[3-[5-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,11,12,14,16-pentahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,17-decahydrocyclopenta[a]phenanthren-16-yl]ethanone |
| InChI Key | DPMVYTYRMGJDQQ-UHFFFAOYSA-N |
| InChI | InChI=1S/C42H68O17/c1-19-29(44)34(53-9)30(45)37(56-19)59-33-21(3)55-28(16-26(33)52-8)58-32-20(2)54-27(15-25(32)51-7)57-24-11-12-38(5)23(14-24)10-13-41(49)35(38)31(46)36(47)39(6)17-40(48,22(4)43)18-42(39,41)50/h10,19-21,24-37,44-50H,11-18H2,1-9H3 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4CCC5(C6C(C(C7(CC(CC7(C6(CC=C5C4)O)O)(C(=O)C)O)C)O)O)C)C)C)O)OC)O |
| Isomeric SMILES | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4CCC5(C6C(C(C7(CC(CC7(C6(CC=C5C4)O)O)(C(=O)C)O)C)O)O)C)C)C)O)OC)O |
| CFM-ID 3.0 | URL Link |
| Related links | Processing, Dining |
| Addition Purposes | Improve flavor |
| Molecular Synonyms |
Esculentin Steroid
AC1L4MQG
AC1Q5CDV
131889-89-9
A809397
1-[3-[4-methoxy-5-[4-methoxy-5-[4-methoxy-6-methyl-3,5-bis(oxidanyl)oxan-2-yl]oxy-6-methyl-oxan-2-yl]oxy-6-methyl-oxan-2-yl]oxy-10,13-dimethyl-8,11,12,14,16-pentakis(oxidanyl)-1,2,3,4,7,9,11,12,15,17-decahydrocyclopenta[a]phenanthren-16-yl]ethanone
1-[3-[5-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,11,12,14,16-pentahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,17-decahydrocyclopenta[a]phenanthren-16-yl]ethanone
16-acetyl-8,11,12,14,16-pentahydroxyandrost-5-en-3-yl 6-deoxy-3-o-methylhexopyranosyl-(1-
Pregn-5-en-20-one, 3-((O-6-deoxy-3-O-methyl-beta-D-glucopyranosyl-(1-4)-O-2,6-dideoxy-3-O-methyl-beta-D-ribo-hexopyranosyl-(1-4)-2,6-dideoxy-3-O-methyl-beta-D-arabino-hexopyranosyl)oxy)-8,11,12,14,17-pentahydroxy-, (3beta,11alpha,12beta,14beta,17alpha)-
1-[3-[[5-[[5-[(3,5-dihydroxy-4-methoxy-6-methyl-2-oxanyl)oxy]-4-methoxy-6-methyl-2-oxanyl]oxy]-4-methoxy-6-methyl-2-oxanyl]oxy]-8,11,12,14,16-pentahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,17-decahydrocyclopenta[a]phenanthren-16-yl]ethanone
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 845 |
| Hydrogen Bond Donor Count | 7 |
| Hydrogen Bond Acceptor Count | 17 |
| Rotatable Bond Count | 10 |
| Complexity | 1570 |
| Monoisotopic Mass | 844.44565073 |
| Exact Mass | 844.44565073 |
| XLogP | -1.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 59 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 22 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5306 |
| Human Intestinal Absorption | HIA+ | 0.6796 |
| Caco-2 Permeability | Caco2- | 0.8237 |
| P-glycoprotein Substrate | Substrate | 0.8611 |
| P-glycoprotein Inhibitor | Inhibitor | 0.5223 |
| Non-inhibitor | 0.7916 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8686 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7157 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8711 |
| CYP450 2D6 Substrate | Non-substrate | 0.8950 |
| CYP450 3A4 Substrate | Substrate | 0.7422 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8776 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9159 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9398 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9182 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9305 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9593 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9727 |
| Non-inhibitor | 0.5849 | |
| AMES Toxicity | Non AMES toxic | 0.9126 |
| Carcinogens | Non-carcinogens | 0.9750 |
| Fish Toxicity | High FHMT | 0.9589 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9969 |
| Honey Bee Toxicity | High HBT | 0.8476 |
| Biodegradation | Not ready biodegradable | 0.9503 |
| Acute Oral Toxicity | II | 0.3964 |
| Carcinogenicity (Three-class) | Non-required | 0.5541 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -4.5843 | LogS |
| Caco-2 Permeability | 0.2197 | LogPapp, cm/s |
| Rat Acute Toxicity | 3.0490 | LD50, mol/kg |
| Fish Toxicity | 0.9594 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.9973 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0092 |
| Food Image | ![]() |
| Food Name | Drinks |
| Food Chinese Name | 饮料 |
| Food Type | Processed food |
| References | None |
References
| Title | DOI/PubMed/ISSN |
|---|
