Scopolin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0240 | 
| Substance Name | Coumarins | 
| Substance Chinese Name | 香豆素类 | 
| Molecular Name | Scopolin | 
| Molecular Chinese Name | 东茛菪苷 | 
| 2D Structure | |
| CAS Number | 531-44-2 | 
| PubChem CID | 439514 | 
| Formula | C16H18O9 | 
| IUPAC Name | 6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one | 
| InChI Key | SGTCGCCQZOUMJJ-YMILTQATSA-N | 
| InChI | InChI=1S/C16H18O9/c1-22-9-4-7-2-3-12(18)23-8(7)5-10(9)24-16-15(21)14(20)13(19)11(6-17)25-16/h2-5,11,13-17,19-21H,6H2,1H3/t11-,13-,14+,15-,16-/m1/s1 | 
| Canonical SMILES | COC1=C(C=C2C(=C1)C=CC(=O)O2)OC3C(C(C(C(O3)CO)O)O)O  | 
| Isomeric SMILES | COC1=C(C=C2C(=C1)C=CC(=O)O2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Dining | 
| Addition Purposes | Improve flavor | 
| Molecular Synonyms | 
        
            Scopolin
        
            Scopoloside
        
            Murrayin
        
            531-44-2
        
            Scopoletin 7-glucoside
        
            UNII-1Y49270PY8
        
            7beta-D-Glucopyranosyloxy-6-methoxycumarin
        
            CHEMBL225024
        
            CHEBI:16065
        
            1Y49270PY8
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 354.31 | 
| Hydrogen Bond Donor Count | 4 | 
| Hydrogen Bond Acceptor Count | 9 | 
| Rotatable Bond Count | 4 | 
| Complexity | 510 | 
| Monoisotopic Mass | 354.09508216 | 
| Exact Mass | 354.09508216 | 
| XLogP | -1.1 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 25 | 
| Defined Atom Stereocenter Count | 5 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.8869 | 
| Human Intestinal Absorption | HIA+ | 0.5078 | 
| Caco-2 Permeability | Caco2- | 0.8679 | 
| P-glycoprotein Substrate | Substrate | 0.6930 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8624 | 
| Non-inhibitor | 0.9059 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8657 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5367 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7643 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8863 | 
| CYP450 3A4 Substrate | Non-substrate | 0.5405 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8772 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9346 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9306 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9158 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9107 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8094 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9646 | 
| Non-inhibitor | 0.7858 | |
| AMES Toxicity | AMES toxic | 0.8140 | 
| Carcinogens | Non-carcinogens | 0.9730 | 
| Fish Toxicity | High FHMT | 0.6064 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9734 | 
| Honey Bee Toxicity | High HBT | 0.6619 | 
| Biodegradation | Ready biodegradable | 0.5175 | 
| Acute Oral Toxicity | III | 0.7058 | 
| Carcinogenicity (Three-class) | Non-required | 0.6881 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -2.0170 | LogS | 
| Caco-2 Permeability | -0.4848 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.1775 | LD50, mol/kg | 
| Fish Toxicity | 1.0500 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.2571 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0092 | 
| Food Image | ![]()  | 
        
| Food Name | Drinks | 
| Food Chinese Name | 饮料 | 
| Food Type | Processed food | 
| References | None | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
Esculin  | 
            
            
            
            
            FRCD  | 
            Link  | 
        
References
| Title | DOI/PubMed/ISSN | 
|---|
