Psoralen
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0244 | 
| Substance Name | Coumarins | 
| Substance Chinese Name | 香豆素类 | 
| Molecular Name | Psoralen | 
| Molecular Chinese Name | 补骨脂内酯 | 
| 2D Structure | |
| CAS Number | 66-97-7 | 
| PubChem CID | 6199 | 
| Formula | C11H6O3 | 
| IUPAC Name | Furo[3,2-g]chromen-7-one | 
| InChI Key | ZCCUUQDIBDJBTK-UHFFFAOYSA-N | 
| InChI | InChI=1S/C11H6O3/c12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h1-6H | 
| Canonical SMILES | C1=CC(=O)OC2=CC3=C(C=CO3)C=C21  | 
| Isomeric SMILES | C1=CC(=O)OC2=CC3=C(C=CO3)C=C21  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Dining | 
| Addition Purposes | Improve flavor | 
| Molecular Synonyms | 
        
            Psoralen
        
            66-97-7
        
            Ficusin
        
            Furocoumarin
        
            Psoralene
        
            7H-Furo[3,2-g][1]benzopyran-7-one
        
            Psorline-P
        
            6,7-Furanocoumarin
        
            Furo[3,2-g]chromen-7-one
        
            7H-Furo[3,2-g]chromen-7-one
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 186.16 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 3 | 
| Rotatable Bond Count | 0 | 
| Complexity | 284 | 
| Monoisotopic Mass | 186.031694052 | 
| Exact Mass | 186.031694052 | 
| XLogP | 2.3 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 14 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9719 | 
| Human Intestinal Absorption | HIA+ | 0.9966 | 
| Caco-2 Permeability | Caco2+ | 0.6155 | 
| P-glycoprotein Substrate | Non-substrate | 0.6821 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8056 | 
| Non-inhibitor | 0.8922 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8028 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6286 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8208 | 
| CYP450 2D6 Substrate | Non-substrate | 0.9092 | 
| CYP450 3A4 Substrate | Non-substrate | 0.7451 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.9107 | 
| CYP450 2C9 Inhibitor | Inhibitor | 0.5345 | 
| CYP450 2D6 Inhibitor | Inhibitor | 0.6769 | 
| CYP450 2C19 Inhibitor | Inhibitor | 0.7951 | 
| CYP450 3A4 Inhibitor | Inhibitor | 0.7675 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6336 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9023 | 
| Non-inhibitor | 0.9689 | |
| AMES Toxicity | Non AMES toxic | 0.9132 | 
| Carcinogens | Non-carcinogens | 0.9509 | 
| Fish Toxicity | High FHMT | 0.8638 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9449 | 
| Honey Bee Toxicity | High HBT | 0.7961 | 
| Biodegradation | Not ready biodegradable | 0.7153 | 
| Acute Oral Toxicity | II | 0.7408 | 
| Carcinogenicity (Three-class) | Warning | 0.4491 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -3.2949 | LogS | 
| Caco-2 Permeability | 1.2133 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.4984 | LD50, mol/kg | 
| Fish Toxicity | 0.3975 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.5187 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0092 | 
| Food Image | ![]()  | 
        
| Food Name | Drinks | 
| Food Chinese Name | 饮料 | 
| Food Type | Processed food | 
| References | None | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
Angelicin  | 
            
            
            
            
            ToxinDB, T3DB, IARC Carcinogens Group 3  | 
            Link  | 
        ||
Methoxsalen  | 
            
            
            
            
            ToxCast & Tox21 Chemicals, T3DB, DrugBank, HPV EPA Chemicals, ToxinDB, IARC Carcinogens Group 1, OECD HPV Chemicals  | 
            Link  | 
        ||
Bergapten  | 
            
            
            
            
            ToxinDB  | 
            Link  | 
        ||
Isobergapten  | 
            
            
            
            
            ToxinDB, T3DB  | 
            Link  | 
        ||
Sphondin  | 
            
            
            
            
            ToxinDB, T3DB  | 
            Link  | 
        ||
4,5'-Dimethylangelicin plus ultraviolet A radiation  | 
            
            
            
            
            IARC Carcinogens Group 3  | 
            Link  | 
        ||
4,4'-Dimethylangelicin plus ultraviolet A radiation  | 
            
            
            
            
            IARC Carcinogens Group 3  | 
            Link  | 
        ||
5-Methylangelicin plus ultraviolet A radiation  | 
            
            
            
            
            IARC Carcinogens Group 3  | 
            Link  | 
        
References
| Title | DOI/PubMed/ISSN | 
|---|
