Xanthotoxol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0245 | 
| Substance Name | Coumarins | 
| Substance Chinese Name | 香豆素类 | 
| Molecular Name | Xanthotoxol | 
| Molecular Chinese Name | 花椒毒酚 | 
| 2D Structure | |
| CAS Number | 2009-24-7 | 
| PubChem CID | 65090 | 
| Formula | C11H6O4 | 
| IUPAC Name | 9-hydroxyfuro[3,2-g]chromen-7-one | 
| InChI Key | JWVYQQGERKEAHW-UHFFFAOYSA-N | 
| InChI | InChI=1S/C11H6O4/c12-8-2-1-6-5-7-3-4-14-10(7)9(13)11(6)15-8/h1-5,13H | 
| Canonical SMILES | C1=CC(=O)OC2=C(C3=C(C=CO3)C=C21)O  | 
| Isomeric SMILES | C1=CC(=O)OC2=C(C3=C(C=CO3)C=C21)O  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Dining | 
| Addition Purposes | Improve flavor | 
| Molecular Synonyms | 
        
            Xanthotoxol
        
            8-Hydroxypsoralen
        
            2009-24-7
        
            8-Hydroxypsoralene
        
            8-Hydroxyfuranocoumarin
        
            7H-Furo[3,2-g][1]benzopyran-7-one, 9-hydroxy-
        
            Xanthotoxol (6CI)
        
            XANTHOTOL
        
            9-Hydroxy-7H-furo[3,2-g]chromen-7-one
        
            Psoralen, 8-hydroxy-
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 202.16 | 
| Hydrogen Bond Donor Count | 1 | 
| Hydrogen Bond Acceptor Count | 4 | 
| Rotatable Bond Count | 0 | 
| Complexity | 312 | 
| Monoisotopic Mass | 202.026608672 | 
| Exact Mass | 202.026608672 | 
| XLogP | 1.6 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 15 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9399 | 
| Human Intestinal Absorption | HIA+ | 0.9811 | 
| Caco-2 Permeability | Caco2- | 0.6754 | 
| P-glycoprotein Substrate | Non-substrate | 0.6459 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8952 | 
| Non-inhibitor | 0.8501 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8601 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6525 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8039 | 
| CYP450 2D6 Substrate | Non-substrate | 0.9073 | 
| CYP450 3A4 Substrate | Non-substrate | 0.7172 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.8392 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7372 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.5847 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6555 | 
| CYP450 3A4 Inhibitor | Inhibitor | 0.6270 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8041 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9677 | 
| Non-inhibitor | 0.9689 | |
| AMES Toxicity | Non AMES toxic | 0.7762 | 
| Carcinogens | Non-carcinogens | 0.9540 | 
| Fish Toxicity | High FHMT | 0.9353 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9352 | 
| Honey Bee Toxicity | High HBT | 0.7707 | 
| Biodegradation | Not ready biodegradable | 0.7065 | 
| Acute Oral Toxicity | II | 0.7376 | 
| Carcinogenicity (Three-class) | Warning | 0.4364 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -3.1089 | LogS | 
| Caco-2 Permeability | 0.6817 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.5923 | LD50, mol/kg | 
| Fish Toxicity | 0.3498 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.2770 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0092 | 
| Food Image | ![]()  | 
        
| Food Name | Drinks | 
| Food Chinese Name | 饮料 | 
| Food Type | Processed food | 
| References | None | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
9-Hydroxy-4-Methoxypsoralen  | 
            
            
            
            
            ToxinDB, T3DB  | 
            Link  | 
        ||
Psoralen  | 
            
            
            
            
            ToxinDB, T3DB  | 
            Link  | 
        ||
9-Hydroxy-4-methoxypsoralen  | 
            
            
            
            
            ToxinDB, T3DB  | 
            Link  | 
        
References
| Title | DOI/PubMed/ISSN | 
|---|
