Isobergapten
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0256 | 
| Substance Name | Coumarins | 
| Substance Chinese Name | 香豆素类 | 
| Molecular Name | Isobergapten | 
| Molecular Chinese Name | 异香柑内酯 | 
| 2D Structure | |
| CAS Number | 482-48-4 | 
| PubChem CID | 68082 | 
| Formula | C12H8O4 | 
| IUPAC Name | 5-methoxyfuro[2,3-h]chromen-2-one | 
| InChI Key | AJSPSRWWZBBIOR-UHFFFAOYSA-N | 
| InChI | InChI=1S/C12H8O4/c1-14-9-6-10-8(4-5-15-10)12-7(9)2-3-11(13)16-12/h2-6H,1H3 | 
| Canonical SMILES | COC1=C2C=CC(=O)OC2=C3C=COC3=C1  | 
| Isomeric SMILES | COC1=C2C=CC(=O)OC2=C3C=COC3=C1  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Dining | 
| Addition Purposes | Improve flavor | 
| Molecular Synonyms | 
        
            Isobergapten
        
            482-48-4
        
            Isobergaptene
        
            UNII-27X3V737WH
        
            2H-Furo[2,3-h]-1-benzopyran-2-one, 5-methoxy-
        
            CHEBI:81487
        
            27X3V737WH
        
            5-methoxyfuro[2,3-h]chromen-2-one
        
            2H-Furo(2,3-h)-1-benzopyran-2-one, 5-methoxy-
        
            5-Methoxy-2H-furo[2,3-H]chromen-2-one
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 216.19 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 4 | 
| Rotatable Bond Count | 1 | 
| Complexity | 325 | 
| Monoisotopic Mass | 216.042258736 | 
| Exact Mass | 216.042258736 | 
| XLogP | 2 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 16 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9254 | 
| Human Intestinal Absorption | HIA+ | 0.9933 | 
| Caco-2 Permeability | Caco2+ | 0.6835 | 
| P-glycoprotein Substrate | Non-substrate | 0.5685 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6457 | 
| Non-inhibitor | 0.6475 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8026 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6414 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7803 | 
| CYP450 2D6 Substrate | Non-substrate | 0.9085 | 
| CYP450 3A4 Substrate | Non-substrate | 0.6413 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.9774 | 
| CYP450 2C9 Inhibitor | Inhibitor | 0.8257 | 
| CYP450 2D6 Inhibitor | Inhibitor | 0.8931 | 
| CYP450 2C19 Inhibitor | Inhibitor | 0.9296 | 
| CYP450 3A4 Inhibitor | Inhibitor | 0.7959 | 
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.7435 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9144 | 
| Non-inhibitor | 0.9676 | |
| AMES Toxicity | AMES toxic | 0.9107 | 
| Carcinogens | Non-carcinogens | 0.9517 | 
| Fish Toxicity | High FHMT | 0.9404 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9852 | 
| Honey Bee Toxicity | High HBT | 0.8462 | 
| Biodegradation | Not ready biodegradable | 0.6650 | 
| Acute Oral Toxicity | III | 0.5714 | 
| Carcinogenicity (Three-class) | Warning | 0.4707 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -3.5245 | LogS | 
| Caco-2 Permeability | 0.9033 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.2791 | LD50, mol/kg | 
| Fish Toxicity | -0.2970 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.7820 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0092 | 
| Food Image | ![]()  | 
        
| Food Name | Drinks | 
| Food Chinese Name | 饮料 | 
| Food Type | Processed food | 
| References | None | 
References
| Title | DOI/PubMed/ISSN | 
|---|
