Poncitrin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0261 |
| Substance Name | Coumarins |
| Substance Chinese Name | 香豆素类 |
| Molecular Name | Poncitrin |
| Molecular Chinese Name | 枸橘内酯 |
| 2D Structure | |
| CAS Number | 22980-57-0 |
| PubChem CID | 342801 |
| Formula | C20H22O4 |
| IUPAC Name | 5-methoxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)pyrano[3,2-g]chromen-8-one |
| InChI Key | QBFYQVZGIDUNIY-UHFFFAOYSA-N |
| InChI | InChI=1S/C20H22O4/c1-7-19(2,3)15-17-12(8-9-14(21)23-17)16(22-6)13-10-11-20(4,5)24-18(13)15/h7-11H,1H2,2-6H3 |
| Canonical SMILES | CC1(C=CC2=C(C3=C(C(=C2O1)C(C)(C)C=C)OC(=O)C=C3)OC)C |
| Isomeric SMILES | CC1(C=CC2=C(C3=C(C(=C2O1)C(C)(C)C=C)OC(=O)C=C3)OC)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing, Dining |
| Addition Purposes | Improve flavor |
| Molecular Synonyms |
Dentatin
22980-57-0
CHEBI:69939
NSC380684
10-(1,1-Dimethyl-allyl)-5-methoxy-8,8-dimethyl-8H-pyrano[3,2-g]chromen-2-one
NSC 380684
AC1L7WZW
CHEMBL552132
DTXSID80177527
10-(1,1-Dimethyl-allyl)-5-methoxy-8,8-dimethyl-8H-pyrano(3,2-g)chromen-2-one
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 326.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Complexity | 586 |
| Monoisotopic Mass | 326.15180919 |
| Exact Mass | 326.15180919 |
| XLogP | 4.7 |
| Formal Charge | 0 |
| Heavy Atom Count | 24 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8375 |
| Human Intestinal Absorption | HIA+ | 0.9690 |
| Caco-2 Permeability | Caco2+ | 0.7928 |
| P-glycoprotein Substrate | Substrate | 0.6440 |
| P-glycoprotein Inhibitor | Inhibitor | 0.8010 |
| Non-inhibitor | 0.5171 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8900 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6646 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8112 |
| CYP450 2D6 Substrate | Non-substrate | 0.8758 |
| CYP450 3A4 Substrate | Substrate | 0.5627 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.6154 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7802 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7786 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.6540 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.7685 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5672 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9806 |
| Non-inhibitor | 0.9593 | |
| AMES Toxicity | AMES toxic | 0.8388 |
| Carcinogens | Non-carcinogens | 0.9036 |
| Fish Toxicity | High FHMT | 0.9847 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9927 |
| Honey Bee Toxicity | High HBT | 0.8770 |
| Biodegradation | Not ready biodegradable | 0.9829 |
| Acute Oral Toxicity | II | 0.4611 |
| Carcinogenicity (Three-class) | Danger | 0.4379 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -4.2390 | LogS |
| Caco-2 Permeability | 1.3640 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.6546 | LD50, mol/kg |
| Fish Toxicity | -0.7510 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.7507 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0092 |
| Food Image | ![]() |
| Food Name | Drinks |
| Food Chinese Name | 饮料 |
| Food Type | Processed food |
| References | None |
References
| Title | DOI/PubMed/ISSN |
|---|
