Poncitrin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0261 | 
| Substance Name | Coumarins | 
| Substance Chinese Name | 香豆素类 | 
| Molecular Name | Poncitrin | 
| Molecular Chinese Name | 枸橘内酯 | 
| 2D Structure | |
| CAS Number | 22980-57-0 | 
| PubChem CID | 342801 | 
| Formula | C20H22O4 | 
| IUPAC Name | 5-methoxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)pyrano[3,2-g]chromen-8-one | 
| InChI Key | QBFYQVZGIDUNIY-UHFFFAOYSA-N | 
| InChI | InChI=1S/C20H22O4/c1-7-19(2,3)15-17-12(8-9-14(21)23-17)16(22-6)13-10-11-20(4,5)24-18(13)15/h7-11H,1H2,2-6H3 | 
| Canonical SMILES | CC1(C=CC2=C(C3=C(C(=C2O1)C(C)(C)C=C)OC(=O)C=C3)OC)C  | 
| Isomeric SMILES | CC1(C=CC2=C(C3=C(C(=C2O1)C(C)(C)C=C)OC(=O)C=C3)OC)C  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Dining | 
| Addition Purposes | Improve flavor | 
| Molecular Synonyms | 
        
            Dentatin
        
            22980-57-0
        
            CHEBI:69939
        
            NSC380684
        
            10-(1,1-Dimethyl-allyl)-5-methoxy-8,8-dimethyl-8H-pyrano[3,2-g]chromen-2-one
        
            NSC 380684
        
            AC1L7WZW
        
            CHEMBL552132
        
            DTXSID80177527
        
            10-(1,1-Dimethyl-allyl)-5-methoxy-8,8-dimethyl-8H-pyrano(3,2-g)chromen-2-one
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 326.4 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 4 | 
| Rotatable Bond Count | 3 | 
| Complexity | 586 | 
| Monoisotopic Mass | 326.15180919 | 
| Exact Mass | 326.15180919 | 
| XLogP | 4.7 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 24 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8375 | 
| Human Intestinal Absorption | HIA+ | 0.9690 | 
| Caco-2 Permeability | Caco2+ | 0.7928 | 
| P-glycoprotein Substrate | Substrate | 0.6440 | 
| P-glycoprotein Inhibitor | Inhibitor | 0.8010 | 
| Non-inhibitor | 0.5171 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8900 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6646 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8112 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8758 | 
| CYP450 3A4 Substrate | Substrate | 0.5627 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.6154 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7802 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7786 | 
| CYP450 2C19 Inhibitor | Inhibitor | 0.6540 | 
| CYP450 3A4 Inhibitor | Inhibitor | 0.7685 | 
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5672 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9806 | 
| Non-inhibitor | 0.9593 | |
| AMES Toxicity | AMES toxic | 0.8388 | 
| Carcinogens | Non-carcinogens | 0.9036 | 
| Fish Toxicity | High FHMT | 0.9847 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9927 | 
| Honey Bee Toxicity | High HBT | 0.8770 | 
| Biodegradation | Not ready biodegradable | 0.9829 | 
| Acute Oral Toxicity | II | 0.4611 | 
| Carcinogenicity (Three-class) | Danger | 0.4379 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -4.2390 | LogS | 
| Caco-2 Permeability | 1.3640 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.6546 | LD50, mol/kg | 
| Fish Toxicity | -0.7510 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 1.7507 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0092 | 
| Food Image | ![]()  | 
        
| Food Name | Drinks | 
| Food Chinese Name | 饮料 | 
| Food Type | Processed food | 
| References | None | 
References
| Title | DOI/PubMed/ISSN | 
|---|
