Seselin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0262 |
| Substance Name | Coumarins |
| Substance Chinese Name | 香豆素类 |
| Molecular Name | Seselin |
| Molecular Chinese Name | 邪蒿内酯 |
| 2D Structure | |
| CAS Number | 523-59-1 |
| PubChem CID | 68229 |
| Formula | C14H12O3 |
| IUPAC Name | 8,8-dimethylpyrano[2,3-f]chromen-2-one |
| InChI Key | QUVCQYQEIOLHFZ-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H12O3/c1-14(2)8-7-10-11(17-14)5-3-9-4-6-12(15)16-13(9)10/h3-8H,1-2H3 |
| Canonical SMILES | CC1(C=CC2=C(O1)C=CC3=C2OC(=O)C=C3)C |
| Isomeric SMILES | CC1(C=CC2=C(O1)C=CC3=C2OC(=O)C=C3)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing, Dining |
| Addition Purposes | Improve flavor |
| Molecular Synonyms |
Seselin
Pyranocoumarin deriv.
Amyrolin
UNII-5634E8957P
CHEMBL71358
CHEBI:69040
8,8-Dimethyl-2H,8H-benzo(1,2-b:3,4-b')dipyran-2-one
8,8-dimethylpyrano[2,3-f]chromen-2-one
523-59-1
8,8-Dimethyl-2H,8H-pyrano[2,3-f]chromen-2-one
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 228.24 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Complexity | 394 |
| Monoisotopic Mass | 228.07864425 |
| Exact Mass | 228.07864425 |
| XLogP | 2.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9256 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.8109 |
| P-glycoprotein Substrate | Substrate | 0.5909 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.5586 |
| Non-inhibitor | 0.8991 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9006 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7604 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7715 |
| CYP450 2D6 Substrate | Non-substrate | 0.9097 |
| CYP450 3A4 Substrate | Non-substrate | 0.5292 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.5346 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.6123 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8226 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.6119 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7482 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5063 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9806 |
| Non-inhibitor | 0.9656 | |
| AMES Toxicity | Non AMES toxic | 0.7756 |
| Carcinogens | Non-carcinogens | 0.9129 |
| Fish Toxicity | High FHMT | 0.9406 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9632 |
| Honey Bee Toxicity | High HBT | 0.8319 |
| Biodegradation | Not ready biodegradable | 0.9795 |
| Acute Oral Toxicity | III | 0.5679 |
| Carcinogenicity (Three-class) | Non-required | 0.5181 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -4.0471 | LogS |
| Caco-2 Permeability | 1.5024 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.1668 | LD50, mol/kg |
| Fish Toxicity | -0.1241 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.4042 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0092 |
| Food Image | ![]() |
| Food Name | Drinks |
| Food Chinese Name | 饮料 |
| Food Type | Processed food |
| References | None |
References
| Title | DOI/PubMed/ISSN |
|---|
