Seselin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0262 | 
| Substance Name | Coumarins | 
| Substance Chinese Name | 香豆素类 | 
| Molecular Name | Seselin | 
| Molecular Chinese Name | 邪蒿内酯 | 
| 2D Structure | |
| CAS Number | 523-59-1 | 
| PubChem CID | 68229 | 
| Formula | C14H12O3 | 
| IUPAC Name | 8,8-dimethylpyrano[2,3-f]chromen-2-one | 
| InChI Key | QUVCQYQEIOLHFZ-UHFFFAOYSA-N | 
| InChI | InChI=1S/C14H12O3/c1-14(2)8-7-10-11(17-14)5-3-9-4-6-12(15)16-13(9)10/h3-8H,1-2H3 | 
| Canonical SMILES | CC1(C=CC2=C(O1)C=CC3=C2OC(=O)C=C3)C  | 
| Isomeric SMILES | CC1(C=CC2=C(O1)C=CC3=C2OC(=O)C=C3)C  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Dining | 
| Addition Purposes | Improve flavor | 
| Molecular Synonyms | 
        
            Seselin
        
            Pyranocoumarin deriv.
        
            Amyrolin
        
            UNII-5634E8957P
        
            CHEMBL71358
        
            CHEBI:69040
        
            8,8-Dimethyl-2H,8H-benzo(1,2-b:3,4-b')dipyran-2-one
        
            8,8-dimethylpyrano[2,3-f]chromen-2-one
        
            523-59-1
        
            8,8-Dimethyl-2H,8H-pyrano[2,3-f]chromen-2-one
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 228.24 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 3 | 
| Rotatable Bond Count | 0 | 
| Complexity | 394 | 
| Monoisotopic Mass | 228.07864425 | 
| Exact Mass | 228.07864425 | 
| XLogP | 2.8 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 17 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9256 | 
| Human Intestinal Absorption | HIA+ | 1.0000 | 
| Caco-2 Permeability | Caco2+ | 0.8109 | 
| P-glycoprotein Substrate | Substrate | 0.5909 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.5586 | 
| Non-inhibitor | 0.8991 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9006 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7604 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7715 | 
| CYP450 2D6 Substrate | Non-substrate | 0.9097 | 
| CYP450 3A4 Substrate | Non-substrate | 0.5292 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.5346 | 
| CYP450 2C9 Inhibitor | Inhibitor | 0.6123 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8226 | 
| CYP450 2C19 Inhibitor | Inhibitor | 0.6119 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7482 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5063 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9806 | 
| Non-inhibitor | 0.9656 | |
| AMES Toxicity | Non AMES toxic | 0.7756 | 
| Carcinogens | Non-carcinogens | 0.9129 | 
| Fish Toxicity | High FHMT | 0.9406 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9632 | 
| Honey Bee Toxicity | High HBT | 0.8319 | 
| Biodegradation | Not ready biodegradable | 0.9795 | 
| Acute Oral Toxicity | III | 0.5679 | 
| Carcinogenicity (Three-class) | Non-required | 0.5181 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -4.0471 | LogS | 
| Caco-2 Permeability | 1.5024 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.1668 | LD50, mol/kg | 
| Fish Toxicity | -0.1241 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 1.4042 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0092 | 
| Food Image | ![]()  | 
        
| Food Name | Drinks | 
| Food Chinese Name | 饮料 | 
| Food Type | Processed food | 
| References | None | 
References
| Title | DOI/PubMed/ISSN | 
|---|
