5-hydroxyseselin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0263 |
| Substance Name | Coumarins |
| Substance Chinese Name | 香豆素类 |
| Molecular Name | 5-hydroxyseselin |
| Molecular Chinese Name | 5-羟基邪蒿内酯 |
| 2D Structure | |
| CAS Number | None |
| PubChem CID | 1334023 |
| Formula | C24H33N3O |
| IUPAC Name | 1-(2-methoxyphenyl)-4-[1-[(3-methylphenyl)methyl]piperidin-4-yl]piperazine |
| InChI Key | RZZOFHVPWHZYRI-UHFFFAOYSA-N |
| InChI | InChI=1S/C24H33N3O/c1-20-6-5-7-21(18-20)19-25-12-10-22(11-13-25)26-14-16-27(17-15-26)23-8-3-4-9-24(23)28-2/h3-9,18,22H,10-17,19H2,1-2H3 |
| Canonical SMILES | CC1=CC(=CC=C1)CN2CCC(CC2)N3CCN(CC3)C4=CC=CC=C4OC |
| Isomeric SMILES | CC1=CC(=CC=C1)CN2CCC(CC2)N3CCN(CC3)C4=CC=CC=C4OC |
| CFM-ID 3.0 | URL Link |
| Related links | Processing, Dining |
| Addition Purposes | Improve flavor |
| Molecular Synonyms |
1-(2-methoxyphenyl)-4-[1-(3-methylbenzyl)piperidin-4-yl]piperazine
AC1LPLMH
Cambridge id 6708762
ZINC1166908
STK094501
AKOS001656886
MCULE-7591045501
AT-057/43318213
1-(2-methoxyphenyl)-4-[1-[(3-methylphenyl)methyl]piperidin-4-yl]piperazine
1-(2-methoxyphenyl)-4-[1-(3-methylbenzyl)-4-piperidinyl]piperazine
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 379.5 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Complexity | 457 |
| Monoisotopic Mass | 379.2623627 |
| Exact Mass | 379.2623627 |
| XLogP | 4.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 28 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9862 |
| Human Intestinal Absorption | HIA+ | 0.9667 |
| Caco-2 Permeability | Caco2+ | 0.5351 |
| P-glycoprotein Substrate | Substrate | 0.7507 |
| P-glycoprotein Inhibitor | Inhibitor | 0.7649 |
| Inhibitor | 0.8626 | |
| Renal Organic Cation Transporter | Inhibitor | 0.6960 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8273 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8204 |
| CYP450 2D6 Substrate | Substrate | 0.5493 |
| CYP450 3A4 Substrate | Substrate | 0.6568 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6009 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9021 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.6566 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5867 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.6459 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.8660 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Strong inhibitor | 0.6129 |
| Inhibitor | 0.8708 | |
| AMES Toxicity | Non AMES toxic | 0.7420 |
| Carcinogens | Non-carcinogens | 0.9319 |
| Fish Toxicity | High FHMT | 0.8670 |
| Tetrahymena Pyriformis Toxicity | Low TPT | 0.5999 |
| Honey Bee Toxicity | Low HBT | 0.8444 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.6739 |
| Carcinogenicity (Three-class) | Non-required | 0.6074 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.4718 | LogS |
| Caco-2 Permeability | 1.1020 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.8290 | LD50, mol/kg |
| Fish Toxicity | 1.4517 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4188 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0092 |
| Food Image | ![]() |
| Food Name | Drinks |
| Food Chinese Name | 饮料 |
| Food Type | Processed food |
| References | None |
References
| Title | DOI/PubMed/ISSN |
|---|
