5-methoxyseselin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0265 | 
| Substance Name | Coumarins | 
| Substance Chinese Name | 香豆素类 | 
| Molecular Name | 5-methoxyseselin | 
| Molecular Chinese Name | 5-甲氧基邪蒿内酯 | 
| 2D Structure | |
| CAS Number | 31525-76-5 | 
| PubChem CID | 290897 | 
| Formula | C15H14O4 | 
| IUPAC Name | 5-methoxy-8,8-dimethylpyrano[2,3-f]chromen-2-one | 
| InChI Key | ZNMRQYJUVCXNGK-UHFFFAOYSA-N | 
| InChI | InChI=1S/C15H14O4/c1-15(2)7-6-10-12(19-15)8-11(17-3)9-4-5-13(16)18-14(9)10/h4-8H,1-3H3 | 
| Canonical SMILES | CC1(C=CC2=C3C(=C(C=C2O1)OC)C=CC(=O)O3)C  | 
| Isomeric SMILES | CC1(C=CC2=C3C(=C(C=C2O1)OC)C=CC(=O)O3)C  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing, Dining | 
| Addition Purposes | Improve flavor | 
| Molecular Synonyms | 
        
            5-Methoxyseselin
        
            CHEMBL479894
        
            31525-76-5
        
            NSC155351
        
            AC1Q6BHD
        
            AC1L6EO9
        
            5-methoxy-8,8-dimethylpyrano[2,3-f]chromen-2-one
        
            CTK4G7296
        
            DTXSID80302933
        
            5-methoxy-8,8-dimethyl-2h,8h-pyrano[2,3-f]chromen-2-one
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 258.27 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 4 | 
| Rotatable Bond Count | 1 | 
| Complexity | 437 | 
| Monoisotopic Mass | 258.08920893 | 
| Exact Mass | 258.08920893 | 
| XLogP | 2.8 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 19 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8482 | 
| Human Intestinal Absorption | HIA+ | 0.9871 | 
| Caco-2 Permeability | Caco2+ | 0.8179 | 
| P-glycoprotein Substrate | Substrate | 0.6386 | 
| P-glycoprotein Inhibitor | Inhibitor | 0.7307 | 
| Inhibitor | 0.5000 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8964 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6940 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7808 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8813 | 
| CYP450 3A4 Substrate | Substrate | 0.5630 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.6377 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7827 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7376 | 
| CYP450 2C19 Inhibitor | Inhibitor | 0.6475 | 
| CYP450 3A4 Inhibitor | Inhibitor | 0.5583 | 
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.6134 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9806 | 
| Non-inhibitor | 0.9577 | |
| AMES Toxicity | AMES toxic | 0.8832 | 
| Carcinogens | Non-carcinogens | 0.9119 | 
| Fish Toxicity | High FHMT | 0.9393 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9890 | 
| Honey Bee Toxicity | High HBT | 0.8835 | 
| Biodegradation | Not ready biodegradable | 0.9757 | 
| Acute Oral Toxicity | III | 0.4420 | 
| Carcinogenicity (Three-class) | Danger | 0.5268 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -4.2665 | LogS | 
| Caco-2 Permeability | 1.3557 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.5571 | LD50, mol/kg | 
| Fish Toxicity | -0.6476 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 1.7077 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0092 | 
| Food Image | ![]()  | 
        
| Food Name | Drinks | 
| Food Chinese Name | 饮料 | 
| Food Type | Processed food | 
| References | None | 
References
| Title | DOI/PubMed/ISSN | 
|---|
