Monocrotophos
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0294 |
| Substance Name | Organophosphorus pesticide |
| Substance Chinese Name | 有机磷农药 |
| Molecular Name | Monocrotophos |
| Molecular Chinese Name | 久效磷 |
| 2D Structure | |
| CAS Number | None |
| PubChem CID | 5371562 |
| Formula | C7H14NO5P |
| IUPAC Name | Dimethyl [(E)-4-(methylamino)-4-oxobut-2-en-2-yl] phosphate |
| InChI Key | KRTSDMXIXPKRQR-AATRIKPKSA-N |
| InChI | InChI=1S/C7H14NO5P/c1-6(5-7(9)8-2)13-14(10,11-3)12-4/h5H,1-4H3,(H,8,9)/b6-5+ |
| Canonical SMILES | CC(=CC(=O)NC)OP(=O)(OC)OC |
| Isomeric SMILES | C/C(=C\C(=O)NC)/OP(=O)(OC)OC |
| CFM-ID 3.0 | URL Link |
| Related links | Transportation, Processing |
| Addition Purposes | Desinsectization |
| Molecular Synonyms |
Azodrin
Nuvacron
Corophos
Monocron
Monostar
Parryfos
Apadrin
Pillardrin
Biloborn
MONOCROTOPHOS
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:29 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 223.16 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 5 |
| Complexity | 267 |
| Monoisotopic Mass | 223.06095955 |
| Exact Mass | 223.06095955 |
| XLogP | -0.2 |
| Formal Charge | 0 |
| Heavy Atom Count | 14 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9644 |
| Human Intestinal Absorption | HIA+ | 0.9238 |
| Caco-2 Permeability | Caco2- | 0.5168 |
| P-glycoprotein Substrate | Non-substrate | 0.8738 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7478 |
| Non-inhibitor | 0.8670 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9589 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7808 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8343 |
| CYP450 2D6 Substrate | Non-substrate | 0.8286 |
| CYP450 3A4 Substrate | Substrate | 0.5104 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7956 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8314 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9205 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7920 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8482 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8883 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9520 |
| Non-inhibitor | 0.9680 | |
| AMES Toxicity | AMES toxic | 0.9108 |
| Carcinogens | Carcinogens | 0.5509 |
| Fish Toxicity | Low FHMT | 0.6004 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.7991 |
| Honey Bee Toxicity | High HBT | 0.8726 |
| Biodegradation | Ready biodegradable | 0.6884 |
| Acute Oral Toxicity | I | 0.7954 |
| Carcinogenicity (Three-class) | Non-required | 0.4417 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | 0.5874 | LogS |
| Caco-2 Permeability | 0.6402 | LogPapp, cm/s |
| Rat Acute Toxicity | 4.4145 | LD50, mol/kg |
| Fish Toxicity | 1.3440 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | -0.1932 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0025 |
| Food Image | ![]() |
| Food Name | Ham |
| Food Chinese Name | 火腿 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
| FADB-China ID | F0027 |
| Food Image | ![]() |
| Food Name | Dried fish |
| Food Chinese Name | 鱼干 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
| FADB-China ID | F0028 |
| Food Image | ![]() |
| Food Name | Salted fish |
| Food Chinese Name | 咸鱼 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Dicrotophos |
FRCD |
Link |


