Blotic
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0296 |
| Substance Name | Organophosphorus pesticide |
| Substance Chinese Name | 有机磷农药 |
| Molecular Name | Blotic |
| Molecular Chinese Name | 巴胺磷 |
| 2D Structure | |
| CAS Number | None |
| PubChem CID | 6434101 |
| Formula | C10H20NO4PS |
| IUPAC Name | Propan-2-yl (Z)-3-[ethylamino(methoxy)phosphinothioyl]oxybut-2-enoate |
| InChI Key | BZNDWPRGXNILMS-CLFYSBASSA-N |
| InChI | InChI=1S/C10H20NO4PS/c1-6-11-16(17,13-5)15-9(4)7-10(12)14-8(2)3/h7-8H,6H2,1-5H3,(H,11,17)/b9-7- |
| Canonical SMILES | CCNP(=S)(OC)OC(=CC(=O)OC(C)C)C |
| Isomeric SMILES | CCNP(=S)(OC)O/C(=C\C(=O)OC(C)C)/C |
| CFM-ID 3.0 | URL Link |
| Related links | Transportation, Processing |
| Addition Purposes | Desinsectization |
| Molecular Synonyms |
Tsar
VEL 4283 (Obs.)
Deadmag
Blotic
Propetamphos [BAN]
Safrotin S 200
Caswell No. 706A
SAN 322I
HSDB 6985
OMS 1502
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:29 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 281.31 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 8 |
| Complexity | 330 |
| Monoisotopic Mass | 281.0850663 |
| Exact Mass | 281.0850663 |
| XLogP | 2.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9021 |
| Human Intestinal Absorption | HIA+ | 0.9830 |
| Caco-2 Permeability | Caco2- | 0.5561 |
| P-glycoprotein Substrate | Non-substrate | 0.8464 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.5690 |
| Non-inhibitor | 0.9347 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9456 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6461 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8698 |
| CYP450 2D6 Substrate | Non-substrate | 0.8210 |
| CYP450 3A4 Substrate | Non-substrate | 0.5350 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6544 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6468 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8858 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5910 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8541 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6067 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9394 |
| Non-inhibitor | 0.8832 | |
| AMES Toxicity | Non AMES toxic | 0.6896 |
| Carcinogens | Carcinogens | 0.5802 |
| Fish Toxicity | High FHMT | 0.8799 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9024 |
| Honey Bee Toxicity | High HBT | 0.9256 |
| Biodegradation | Not ready biodegradable | 0.7002 |
| Acute Oral Toxicity | II | 0.7401 |
| Carcinogenicity (Three-class) | Non-required | 0.5875 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.3475 | LogS |
| Caco-2 Permeability | 0.5381 | LogPapp, cm/s |
| Rat Acute Toxicity | 3.6851 | LD50, mol/kg |
| Fish Toxicity | 1.4410 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | -0.1690 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0025 |
| Food Image | ![]() |
| Food Name | Ham |
| Food Chinese Name | 火腿 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
| FADB-China ID | F0027 |
| Food Image | ![]() |
| Food Name | Dried fish |
| Food Chinese Name | 鱼干 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
| FADB-China ID | F0028 |
| Food Image | ![]() |
| Food Name | Salted fish |
| Food Chinese Name | 咸鱼 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |


