Kitazin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0301 |
| Substance Name | Organophosphorus pesticide |
| Substance Chinese Name | 有机磷农药 |
| Molecular Name | Kitazin |
| Molecular Chinese Name | 稻瘟净 |
| 2D Structure | |
| CAS Number | 13286-32-3 |
| PubChem CID | 25834 |
| Formula | C11H17O3PS |
| IUPAC Name | Diethoxyphosphorylsulfanylmethylbenzene |
| InChI Key | XFMJUIKWKVJNDY-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H17O3PS/c1-3-13-15(12,14-4-2)16-10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| Canonical SMILES | CCOP(=O)(OCC)SCC1=CC=CC=C1 |
| Isomeric SMILES | CCOP(=O)(OCC)SCC1=CC=CC=C1 |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Desinsectization |
| Molecular Synonyms |
Kitazin
Kitazine
13286-32-3
Ritacin-P [Russian]
O,O-Diethyl S-benzyl thiophosphate
O,O-DIETHYL S-BENZYL PHOSPHOROTHIOATE
Diethoxyphosphorylsulfanylmethylbenzene
Phosphorothioic acid, O,O-diethyl S-(phenylmethyl) ester
Ricide
S-Benzyl O,O-diethyl phosphorothioate
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:31 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 260.29 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 7 |
| Complexity | 219 |
| Monoisotopic Mass | 260.06360258 |
| Exact Mass | 260.06360258 |
| XLogP | 2.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 16 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9449 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.5258 |
| P-glycoprotein Substrate | Non-substrate | 0.7604 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7282 |
| Non-inhibitor | 0.9579 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8811 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7275 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8174 |
| CYP450 2D6 Substrate | Non-substrate | 0.7775 |
| CYP450 3A4 Substrate | Non-substrate | 0.6562 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7565 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7185 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9171 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6880 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8054 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5353 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8376 |
| Non-inhibitor | 0.9017 | |
| AMES Toxicity | Non AMES toxic | 0.8839 |
| Carcinogens | Carcinogens | 0.6689 |
| Fish Toxicity | High FHMT | 0.9432 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9766 |
| Honey Bee Toxicity | High HBT | 0.9352 |
| Biodegradation | Not ready biodegradable | 0.6925 |
| Acute Oral Toxicity | III | 0.8375 |
| Carcinogenicity (Three-class) | Non-required | 0.6270 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -4.2435 | LogS |
| Caco-2 Permeability | 0.9767 | LogPapp, cm/s |
| Rat Acute Toxicity | 3.3146 | LD50, mol/kg |
| Fish Toxicity | 2.0928 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1760 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0025 |
| Food Image | ![]() |
| Food Name | Ham |
| Food Chinese Name | 火腿 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
| FADB-China ID | F0027 |
| Food Image | ![]() |
| Food Name | Dried fish |
| Food Chinese Name | 鱼干 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
| FADB-China ID | F0028 |
| Food Image | ![]() |
| Food Name | Salted fish |
| Food Chinese Name | 咸鱼 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Iprobenfos |
FRCD |
Link |


