Fenamiphos
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0305 |
| Substance Name | Organophosphorus pesticide |
| Substance Chinese Name | 有机磷农药 |
| Molecular Name | Fenamiphos |
| Molecular Chinese Name | 克线磷 |
| 2D Structure | |
| CAS Number | 22224-92-6 |
| PubChem CID | 31070 |
| Formula | C13H22NO3PS |
| IUPAC Name | N-[ethoxy-(3-methyl-4-methylsulfanylphenoxy)phosphoryl]propan-2-amine |
| InChI Key | ZCJPOPBZHLUFHF-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H22NO3PS/c1-6-16-18(15,14-10(2)3)17-12-7-8-13(19-5)11(4)9-12/h7-10H,6H2,1-5H3,(H,14,15) |
| Canonical SMILES | CCOP(=O)(NC(C)C)OC1=CC(=C(C=C1)SC)C |
| Isomeric SMILES | CCOP(=O)(NC(C)C)OC1=CC(=C(C=C1)SC)C |
| CFM-ID 3.0 | URL Link |
| Related links | Transportation, Processing |
| Addition Purposes | Desinsectization |
| Molecular Synonyms |
FENAMIPHOS
Phenamiphos
Nemacur
22224-92-6
Nemacur P
Methaphenamiphos
BAY sra 3886
Fenamiphos [BSI:ISO]
BAY 68138
Caswell No. 453A
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:33 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 303.36 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 7 |
| Complexity | 314 |
| Monoisotopic Mass | 303.10580175 |
| Exact Mass | 303.10580175 |
| XLogP | 3.2 |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9121 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.5216 |
| P-glycoprotein Substrate | Non-substrate | 0.8404 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6326 |
| Non-inhibitor | 0.9587 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8877 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7909 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8215 |
| CYP450 2D6 Substrate | Non-substrate | 0.6801 |
| CYP450 3A4 Substrate | Substrate | 0.5597 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.6919 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6127 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8647 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.6161 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8022 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.6644 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9301 |
| Non-inhibitor | 0.8129 | |
| AMES Toxicity | Non AMES toxic | 0.9132 |
| Carcinogens | Non-carcinogens | 0.6741 |
| Fish Toxicity | High FHMT | 0.9057 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8274 |
| Honey Bee Toxicity | High HBT | 0.8934 |
| Biodegradation | Not ready biodegradable | 0.9786 |
| Acute Oral Toxicity | I | 0.7933 |
| Carcinogenicity (Three-class) | Non-required | 0.5742 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.4157 | LogS |
| Caco-2 Permeability | 1.0754 | LogPapp, cm/s |
| Rat Acute Toxicity | 4.5478 | LD50, mol/kg |
| Fish Toxicity | 1.3693 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1183 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0025 |
| Food Image | ![]() |
| Food Name | Ham |
| Food Chinese Name | 火腿 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
| FADB-China ID | F0027 |
| Food Image | ![]() |
| Food Name | Dried fish |
| Food Chinese Name | 鱼干 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
| FADB-China ID | F0028 |
| Food Image | ![]() |
| Food Name | Salted fish |
| Food Chinese Name | 咸鱼 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |


