Diethion
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0306 |
| Substance Name | Organophosphorus pesticide |
| Substance Chinese Name | 有机磷农药 |
| Molecular Name | Diethion |
| Molecular Chinese Name | 乙硫磷 |
| 2D Structure | |
| CAS Number | 563-12-2 |
| PubChem CID | 3286 |
| Formula | C9H22O4P2S4 |
| IUPAC Name | Diethoxyphosphinothioylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane |
| InChI Key | RIZMRRKBZQXFOY-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H22O4P2S4/c1-5-10-14(16,11-6-2)18-9-19-15(17,12-7-3)13-8-4/h5-9H2,1-4H3 |
| Canonical SMILES | CCOP(=S)(OCC)SCSP(=S)(OCC)OCC |
| Isomeric SMILES | CCOP(=S)(OCC)SCSP(=S)(OCC)OCC |
| CFM-ID 3.0 | URL Link |
| Related links | Transportation, Processing |
| Addition Purposes | Desinsectization |
| Molecular Synonyms |
Ethion
Diethion
563-12-2
Ethanox
Ethopaz
Embathion
Rhodocide
Ethodan
Hylemox
Nialate
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:33 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 384.5 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 12 |
| Complexity | 279 |
| Monoisotopic Mass | 383.98761788 |
| Exact Mass | 383.98761788 |
| XLogP | 5.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8971 |
| Human Intestinal Absorption | HIA+ | 0.9878 |
| Caco-2 Permeability | Caco2- | 0.5437 |
| P-glycoprotein Substrate | Non-substrate | 0.8457 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7028 |
| Non-inhibitor | 0.9205 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9406 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6257 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8357 |
| CYP450 2D6 Substrate | Non-substrate | 0.8439 |
| CYP450 3A4 Substrate | Non-substrate | 0.6242 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8505 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7455 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9167 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7497 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.5223 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7021 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8863 |
| Non-inhibitor | 0.9242 | |
| AMES Toxicity | Non AMES toxic | 0.9133 |
| Carcinogens | Carcinogens | 0.7577 |
| Fish Toxicity | High FHMT | 0.7948 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.6571 |
| Honey Bee Toxicity | High HBT | 0.9543 |
| Biodegradation | Not ready biodegradable | 0.9121 |
| Acute Oral Toxicity | I | 0.8371 |
| Carcinogenicity (Three-class) | Non-required | 0.6643 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -4.4469 | LogS |
| Caco-2 Permeability | 0.7259 | LogPapp, cm/s |
| Rat Acute Toxicity | 4.1074 | LD50, mol/kg |
| Fish Toxicity | 2.1854 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | -0.4379 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0025 |
| Food Image | ![]() |
| Food Name | Ham |
| Food Chinese Name | 火腿 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
| FADB-China ID | F0027 |
| Food Image | ![]() |
| Food Name | Dried fish |
| Food Chinese Name | 鱼干 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |
| FADB-China ID | F0028 |
| Food Image | ![]() |
| Food Name | Salted fish |
| Food Chinese Name | 咸鱼 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (third batch) |


