Sulfachloropyridazine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0316 |
| Substance Name | Sulfonamides |
| Substance Chinese Name | 磺胺类药物 |
| Molecular Name | Sulfachloropyridazine |
| Molecular Chinese Name | 磺胺氯哒嗪 |
| 2D Structure | |
| CAS Number | 80-32-0 |
| PubChem CID | 6634 |
| Formula | C10H9ClN4O2S |
| IUPAC Name | 4-amino-N-(6-chloropyridazin-3-yl)benzenesulfonamide |
| InChI Key | XOXHILFPRYWFOD-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H9ClN4O2S/c11-9-5-6-10(14-13-9)15-18(16,17)8-3-1-7(12)2-4-8/h1-6H,12H2,(H,14,15) |
| Canonical SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=NN=C(C=C2)Cl |
| Isomeric SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=NN=C(C=C2)Cl |
| CFM-ID 3.0 | URL Link |
| Related links | Dining |
| Addition Purposes | Sterilization, Antiseptic |
| Molecular Synonyms |
Sulfachloropyridazine
Sulfachlorpyridazine
80-32-0
Nefrosul
Sulphachlorpyridazine
Sulfacloropiridazina
Durasulf
Sulfachlorpyridazinum
Sonilyn
4-amino-N-(6-chloropyridazin-3-yl)benzenesulfonamide
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:36 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 284.72 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 3 |
| Complexity | 365 |
| Monoisotopic Mass | 284.0134744 |
| Exact Mass | 284.0134744 |
| XLogP | 1 |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8567 |
| Human Intestinal Absorption | HIA+ | 0.9889 |
| Caco-2 Permeability | Caco2+ | 0.6351 |
| P-glycoprotein Substrate | Non-substrate | 0.8630 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9045 |
| Non-inhibitor | 0.9675 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8663 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5027 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8401 |
| CYP450 2D6 Substrate | Non-substrate | 0.8668 |
| CYP450 3A4 Substrate | Non-substrate | 0.7233 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9046 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9070 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8309 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7786 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8743 |
| Non-inhibitor | 0.8772 | |
| AMES Toxicity | Non AMES toxic | 0.8999 |
| Carcinogens | Non-carcinogens | 0.8564 |
| Fish Toxicity | High FHMT | 0.5283 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9090 |
| Honey Bee Toxicity | Low HBT | 0.8488 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.6172 |
| Carcinogenicity (Three-class) | Non-required | 0.5299 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.7814 | LogS |
| Caco-2 Permeability | 1.0859 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.1508 | LD50, mol/kg |
| Fish Toxicity | 1.6752 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.6295 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0079 |
| Food Image | ![]() |
| Food Name | Animal fishery products |
| Food Chinese Name | 动物性水产品 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Sulfamethoxypyridazine |
CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
Link |
