Sulfadimoxine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0318 |
| Substance Name | Sulfonamides |
| Substance Chinese Name | 磺胺类药物 |
| Molecular Name | Sulfadimoxine |
| Molecular Chinese Name | 磺胺邻二甲氧嘧啶 |
| 2D Structure | |
| CAS Number | 2447-57-6 |
| PubChem CID | 17134 |
| Formula | C12H14N4O4S |
| IUPAC Name | 4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
| InChI Key | PJSFRIWCGOHTNF-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H14N4O4S/c1-19-10-11(14-7-15-12(10)20-2)16-21(17,18)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H,14,15,16) |
| Canonical SMILES | COC1=C(N=CN=C1OC)NS(=O)(=O)C2=CC=C(C=C2)N |
| Isomeric SMILES | COC1=C(N=CN=C1OC)NS(=O)(=O)C2=CC=C(C=C2)N |
| CFM-ID 3.0 | URL Link |
| Related links | Dining |
| Addition Purposes | Sterilization, Antiseptic |
| Molecular Synonyms |
SULFADOXINE
2447-57-6
Sulphadoxine
Sulforthomidine
Fanasil
Sulphormethoxine
Sulfadoxin
Sulfadoxina
Sulfadoxinum
4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:37 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 310.33 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 5 |
| Complexity | 420 |
| Monoisotopic Mass | 310.07357612 |
| Exact Mass | 310.07357612 |
| XLogP | 0.7 |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.5345 |
| Human Intestinal Absorption | HIA+ | 0.9602 |
| Caco-2 Permeability | Caco2- | 0.5900 |
| P-glycoprotein Substrate | Non-substrate | 0.8126 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8320 |
| Non-inhibitor | 0.8892 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9164 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4890 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6930 |
| CYP450 2D6 Substrate | Non-substrate | 0.9116 |
| CYP450 3A4 Substrate | Non-substrate | 0.6464 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9026 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8703 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.6052 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9907 |
| Non-inhibitor | 0.7221 | |
| AMES Toxicity | Non AMES toxic | 0.6456 |
| Carcinogens | Non-carcinogens | 0.8265 |
| Fish Toxicity | Low FHMT | 0.8230 |
| Tetrahymena Pyriformis Toxicity | Low TPT | 0.6400 |
| Honey Bee Toxicity | Low HBT | 0.8331 |
| Biodegradation | Not ready biodegradable | 0.9960 |
| Acute Oral Toxicity | III | 0.5764 |
| Carcinogenicity (Three-class) | Non-required | 0.5473 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.8846 | LogS |
| Caco-2 Permeability | 0.7364 | LogPapp, cm/s |
| Rat Acute Toxicity | 1.8756 | LD50, mol/kg |
| Fish Toxicity | 1.7442 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.2564 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0079 |
| Food Image | ![]() |
| Food Name | Animal fishery products |
| Food Chinese Name | 动物性水产品 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Sulfamonomethoxine |
FRCD |
Link |
