Sulfadimoxine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0318 | 
| Substance Name | Sulfonamides | 
| Substance Chinese Name | 磺胺类药物 | 
| Molecular Name | Sulfadimoxine | 
| Molecular Chinese Name | 磺胺邻二甲氧嘧啶 | 
| 2D Structure | |
| CAS Number | 2447-57-6 | 
| PubChem CID | 17134 | 
| Formula | C12H14N4O4S | 
| IUPAC Name | 4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide | 
| InChI Key | PJSFRIWCGOHTNF-UHFFFAOYSA-N | 
| InChI | InChI=1S/C12H14N4O4S/c1-19-10-11(14-7-15-12(10)20-2)16-21(17,18)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H,14,15,16) | 
| Canonical SMILES | COC1=C(N=CN=C1OC)NS(=O)(=O)C2=CC=C(C=C2)N  | 
| Isomeric SMILES | COC1=C(N=CN=C1OC)NS(=O)(=O)C2=CC=C(C=C2)N  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Dining | 
| Addition Purposes | Sterilization, Antiseptic | 
| Molecular Synonyms | 
        
            SULFADOXINE
        
            2447-57-6
        
            Sulphadoxine
        
            Sulforthomidine
        
            Fanasil
        
            Sulphormethoxine
        
            Sulfadoxin
        
            Sulfadoxina
        
            Sulfadoxinum
        
            4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:37 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 310.33 | 
| Hydrogen Bond Donor Count | 2 | 
| Hydrogen Bond Acceptor Count | 8 | 
| Rotatable Bond Count | 5 | 
| Complexity | 420 | 
| Monoisotopic Mass | 310.07357612 | 
| Exact Mass | 310.07357612 | 
| XLogP | 0.7 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 21 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.5345 | 
| Human Intestinal Absorption | HIA+ | 0.9602 | 
| Caco-2 Permeability | Caco2- | 0.5900 | 
| P-glycoprotein Substrate | Non-substrate | 0.8126 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8320 | 
| Non-inhibitor | 0.8892 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9164 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4890 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6930 | 
| CYP450 2D6 Substrate | Non-substrate | 0.9116 | 
| CYP450 3A4 Substrate | Non-substrate | 0.6464 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9026 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8703 | 
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.6052 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9907 | 
| Non-inhibitor | 0.7221 | |
| AMES Toxicity | Non AMES toxic | 0.6456 | 
| Carcinogens | Non-carcinogens | 0.8265 | 
| Fish Toxicity | Low FHMT | 0.8230 | 
| Tetrahymena Pyriformis Toxicity | Low TPT | 0.6400 | 
| Honey Bee Toxicity | Low HBT | 0.8331 | 
| Biodegradation | Not ready biodegradable | 0.9960 | 
| Acute Oral Toxicity | III | 0.5764 | 
| Carcinogenicity (Three-class) | Non-required | 0.5473 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -2.8846 | LogS | 
| Caco-2 Permeability | 0.7364 | LogPapp, cm/s | 
| Rat Acute Toxicity | 1.8756 | LD50, mol/kg | 
| Fish Toxicity | 1.7442 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.2564 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0079 | 
| Food Image | ![]()  | 
        
| Food Name | Animal fishery products | 
| Food Chinese Name | 动物性水产品 | 
| Food Type | Processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
Sulfamonomethoxine  | 
            
            
            
            
            FRCD  | 
            Link  | 
        
