Florfenicol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0328 | 
| Substance Name | Chloramphenicol | 
| Substance Chinese Name | 氯霉素类药物 | 
| Molecular Name | Florfenicol | 
| Molecular Chinese Name | 氟甲砜霉素 | 
| 2D Structure | |
| CAS Number | 73231-34-2 | 
| PubChem CID | 114811 | 
| Formula | C12H14Cl2FNO4S | 
| IUPAC Name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
| InChI Key | AYIRNRDRBQJXIF-NXEZZACHSA-N | 
| InChI | InChI=1S/C12H14Cl2FNO4S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-15)16-12(18)11(13)14/h2-5,9-11,17H,6H2,1H3,(H,16,18)/t9-,10-/m1/s1 | 
| Canonical SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(C(CF)NC(=O)C(Cl)Cl)O  | 
| Isomeric SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CF)NC(=O)C(Cl)Cl)O  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Dining | 
| Addition Purposes | Sterilization, Antiseptic | 
| Molecular Synonyms | 
        
            Florfenicol
        
            73231-34-2
        
            Nuflor
        
            Sch-25298
        
            (-)-Florfenicol
        
            76639-94-6
        
            Nuflor gold
        
            Sch 25298
        
            Florphenicol
        
            Aquafen
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:41 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 358.2 | 
| Hydrogen Bond Donor Count | 2 | 
| Hydrogen Bond Acceptor Count | 5 | 
| Rotatable Bond Count | 6 | 
| Complexity | 447 | 
| Monoisotopic Mass | 357.0004627 | 
| Exact Mass | 357.0004627 | 
| XLogP | 0.8 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 21 | 
| Defined Atom Stereocenter Count | 2 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9437 | 
| Human Intestinal Absorption | HIA+ | 0.9767 | 
| Caco-2 Permeability | Caco2- | 0.6179 | 
| P-glycoprotein Substrate | Non-substrate | 0.7405 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9421 | 
| Non-inhibitor | 0.9666 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9225 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6070 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6049 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8078 | 
| CYP450 3A4 Substrate | Non-substrate | 0.5388 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9046 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9026 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8308 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8681 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9973 | 
| Non-inhibitor | 0.9057 | |
| AMES Toxicity | Non AMES toxic | 0.7521 | 
| Carcinogens | Non-carcinogens | 0.6382 | 
| Fish Toxicity | High FHMT | 0.5644 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.5901 | 
| Honey Bee Toxicity | Low HBT | 0.6486 | 
| Biodegradation | Not ready biodegradable | 0.8732 | 
| Acute Oral Toxicity | III | 0.5858 | 
| Carcinogenicity (Three-class) | Non-required | 0.6826 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -2.5258 | LogS | 
| Caco-2 Permeability | 0.4988 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.3560 | LD50, mol/kg | 
| Fish Toxicity | 1.8001 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | -0.2021 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0088 | 
| Food Image | ![]()  | 
        
| Food Name | Raw aquatic products | 
| Food Chinese Name | 生食水产品 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
| FADB-China ID | F0089 | 
| Food Image | ![]()  | 
        
| Food Name | Hog casing | 
| Food Chinese Name | 猪肠衣 | 
| Food Type | Processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
| FADB-China ID | F0090 | 
| Food Image | ![]()  | 
        
| Food Name | Honey | 
| Food Chinese Name | 蜂蜜 | 
| Food Type | Processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
Thiamphenicol  | 
            
            
            
            
            DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals  | 
            Link  | 
        


