Florfenicol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0328 |
| Substance Name | Chloramphenicol |
| Substance Chinese Name | 氯霉素类药物 |
| Molecular Name | Florfenicol |
| Molecular Chinese Name | 氟甲砜霉素 |
| 2D Structure | |
| CAS Number | 73231-34-2 |
| PubChem CID | 114811 |
| Formula | C12H14Cl2FNO4S |
| IUPAC Name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| InChI Key | AYIRNRDRBQJXIF-NXEZZACHSA-N |
| InChI | InChI=1S/C12H14Cl2FNO4S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-15)16-12(18)11(13)14/h2-5,9-11,17H,6H2,1H3,(H,16,18)/t9-,10-/m1/s1 |
| Canonical SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(C(CF)NC(=O)C(Cl)Cl)O |
| Isomeric SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CF)NC(=O)C(Cl)Cl)O |
| CFM-ID 3.0 | URL Link |
| Related links | Dining |
| Addition Purposes | Sterilization, Antiseptic |
| Molecular Synonyms |
Florfenicol
73231-34-2
Nuflor
Sch-25298
(-)-Florfenicol
76639-94-6
Nuflor gold
Sch 25298
Florphenicol
Aquafen
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:41 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 358.2 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Complexity | 447 |
| Monoisotopic Mass | 357.0004627 |
| Exact Mass | 357.0004627 |
| XLogP | 0.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9437 |
| Human Intestinal Absorption | HIA+ | 0.9767 |
| Caco-2 Permeability | Caco2- | 0.6179 |
| P-glycoprotein Substrate | Non-substrate | 0.7405 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9421 |
| Non-inhibitor | 0.9666 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9225 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6070 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6049 |
| CYP450 2D6 Substrate | Non-substrate | 0.8078 |
| CYP450 3A4 Substrate | Non-substrate | 0.5388 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9046 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9026 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8308 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8681 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9973 |
| Non-inhibitor | 0.9057 | |
| AMES Toxicity | Non AMES toxic | 0.7521 |
| Carcinogens | Non-carcinogens | 0.6382 |
| Fish Toxicity | High FHMT | 0.5644 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.5901 |
| Honey Bee Toxicity | Low HBT | 0.6486 |
| Biodegradation | Not ready biodegradable | 0.8732 |
| Acute Oral Toxicity | III | 0.5858 |
| Carcinogenicity (Three-class) | Non-required | 0.6826 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.5258 | LogS |
| Caco-2 Permeability | 0.4988 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.3560 | LD50, mol/kg |
| Fish Toxicity | 1.8001 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | -0.2021 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0088 |
| Food Image | ![]() |
| Food Name | Raw aquatic products |
| Food Chinese Name | 生食水产品 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
| FADB-China ID | F0089 |
| Food Image | ![]() |
| Food Name | Hog casing |
| Food Chinese Name | 猪肠衣 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
| FADB-China ID | F0090 |
| Food Image | ![]() |
| Food Name | Honey |
| Food Chinese Name | 蜂蜜 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Thiamphenicol |
DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
Link |


