Thiamphenicol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0329 |
| Substance Name | Chloramphenicol |
| Substance Chinese Name | 氯霉素类药物 |
| Molecular Name | Thiamphenicol |
| Molecular Chinese Name | 甲砜霉素 |
| 2D Structure | |
| CAS Number | 15318-45-3 |
| PubChem CID | 27200 |
| Formula | C12H15Cl2NO5S |
| IUPAC Name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| InChI Key | OTVAEFIXJLOWRX-NXEZZACHSA-N |
| InChI | InChI=1S/C12H15Cl2NO5S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-16)15-12(18)11(13)14/h2-5,9-11,16-17H,6H2,1H3,(H,15,18)/t9-,10-/m1/s1 |
| Canonical SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(C(CO)NC(=O)C(Cl)Cl)O |
| Isomeric SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O |
| CFM-ID 3.0 | URL Link |
| Related links | Dining |
| Addition Purposes | Sterilization, Antiseptic |
| Molecular Synonyms |
Thiamphenicol
15318-45-3
Thiophenicol
Thiamcol
(+)-Thiamphenicol
Dextrosulphenidol
Raceophenidol
Thiamphenicolum
D-Thiocymetin
D-Thiophenicol
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:41 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 356.2 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Complexity | 443 |
| Monoisotopic Mass | 355.0047991 |
| Exact Mass | 355.0047991 |
| XLogP | -0.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9383 |
| Human Intestinal Absorption | HIA+ | 0.9310 |
| Caco-2 Permeability | Caco2- | 0.6100 |
| P-glycoprotein Substrate | Non-substrate | 0.7574 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9489 |
| Non-inhibitor | 0.9432 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9236 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5160 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.5856 |
| CYP450 2D6 Substrate | Non-substrate | 0.8164 |
| CYP450 3A4 Substrate | Non-substrate | 0.5896 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8310 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8529 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9972 |
| Non-inhibitor | 0.9289 | |
| AMES Toxicity | Non AMES toxic | 0.7181 |
| Carcinogens | Non-carcinogens | 0.6535 |
| Fish Toxicity | Low FHMT | 0.6448 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.6899 |
| Honey Bee Toxicity | Low HBT | 0.6274 |
| Biodegradation | Ready biodegradable | 0.7060 |
| Acute Oral Toxicity | III | 0.5991 |
| Carcinogenicity (Three-class) | Non-required | 0.6945 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.2124 | LogS |
| Caco-2 Permeability | 0.4964 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.2718 | LD50, mol/kg |
| Fish Toxicity | 1.8372 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | -0.0484 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0088 |
| Food Image | ![]() |
| Food Name | Raw aquatic products |
| Food Chinese Name | 生食水产品 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
| FADB-China ID | F0089 |
| Food Image | ![]() |
| Food Name | Hog casing |
| Food Chinese Name | 猪肠衣 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
| FADB-China ID | F0090 |
| Food Image | ![]() |
| Food Name | Honey |
| Food Chinese Name | 蜂蜜 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Florfenicol |
CAC Veterinary Drug |
Link |


