Thiamphenicol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0329 | 
| Substance Name | Chloramphenicol | 
| Substance Chinese Name | 氯霉素类药物 | 
| Molecular Name | Thiamphenicol | 
| Molecular Chinese Name | 甲砜霉素 | 
| 2D Structure | |
| CAS Number | 15318-45-3 | 
| PubChem CID | 27200 | 
| Formula | C12H15Cl2NO5S | 
| IUPAC Name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
| InChI Key | OTVAEFIXJLOWRX-NXEZZACHSA-N | 
| InChI | InChI=1S/C12H15Cl2NO5S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-16)15-12(18)11(13)14/h2-5,9-11,16-17H,6H2,1H3,(H,15,18)/t9-,10-/m1/s1 | 
| Canonical SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(C(CO)NC(=O)C(Cl)Cl)O  | 
| Isomeric SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Dining | 
| Addition Purposes | Sterilization, Antiseptic | 
| Molecular Synonyms | 
        
            Thiamphenicol
        
            15318-45-3
        
            Thiophenicol
        
            Thiamcol
        
            (+)-Thiamphenicol
        
            Dextrosulphenidol
        
            Raceophenidol
        
            Thiamphenicolum
        
            D-Thiocymetin
        
            D-Thiophenicol
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:41 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 356.2 | 
| Hydrogen Bond Donor Count | 3 | 
| Hydrogen Bond Acceptor Count | 5 | 
| Rotatable Bond Count | 6 | 
| Complexity | 443 | 
| Monoisotopic Mass | 355.0047991 | 
| Exact Mass | 355.0047991 | 
| XLogP | -0.3 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 21 | 
| Defined Atom Stereocenter Count | 2 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9383 | 
| Human Intestinal Absorption | HIA+ | 0.9310 | 
| Caco-2 Permeability | Caco2- | 0.6100 | 
| P-glycoprotein Substrate | Non-substrate | 0.7574 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9489 | 
| Non-inhibitor | 0.9432 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9236 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5160 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.5856 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8164 | 
| CYP450 3A4 Substrate | Non-substrate | 0.5896 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8310 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8529 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9972 | 
| Non-inhibitor | 0.9289 | |
| AMES Toxicity | Non AMES toxic | 0.7181 | 
| Carcinogens | Non-carcinogens | 0.6535 | 
| Fish Toxicity | Low FHMT | 0.6448 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.6899 | 
| Honey Bee Toxicity | Low HBT | 0.6274 | 
| Biodegradation | Ready biodegradable | 0.7060 | 
| Acute Oral Toxicity | III | 0.5991 | 
| Carcinogenicity (Three-class) | Non-required | 0.6945 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -2.2124 | LogS | 
| Caco-2 Permeability | 0.4964 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.2718 | LD50, mol/kg | 
| Fish Toxicity | 1.8372 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | -0.0484 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0088 | 
| Food Image | ![]()  | 
        
| Food Name | Raw aquatic products | 
| Food Chinese Name | 生食水产品 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
| FADB-China ID | F0089 | 
| Food Image | ![]()  | 
        
| Food Name | Hog casing | 
| Food Chinese Name | 猪肠衣 | 
| Food Type | Processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
| FADB-China ID | F0090 | 
| Food Image | ![]()  | 
        
| Food Name | Honey | 
| Food Chinese Name | 蜂蜜 | 
| Food Type | Processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
Florfenicol  | 
            
            
            
            
            CAC Veterinary Drug  | 
            Link  | 
        


