Demeclocycline
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0333 | 
| Substance Name | Tetracycline | 
| Substance Chinese Name | 四环素类药物 | 
| Molecular Name | Demeclocycline | 
| Molecular Chinese Name | 去甲金霉素 | 
| 2D Structure | |
| CAS Number | None | 
| PubChem CID | 54680690 | 
| Formula | C21H21ClN2O8 | 
| IUPAC Name | (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide | 
| InChI Key | GUXHBMASAHGULD-SEYHBJAFSA-N | 
| InChI | InChI=1S/C21H21ClN2O8/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31/h3-4,6-7,14-15,25-27,30,32H,5H2,1-2H3,(H2,23,31)/t6-,7-,14-,15-,21-/m0/s1 | 
| Canonical SMILES | CN(C)C1C2CC3C(C4=C(C=CC(=C4C(=C3C(=O)C2(C(=C(C1=O)C(=O)N)O)O)O)O)Cl)O  | 
| Isomeric SMILES | CN(C)[C@H]1[C@@H]2C[C@@H]3[C@@H](C4=C(C=CC(=C4C(=C3C(=O)[C@@]2(C(=C(C1=O)C(=O)N)O)O)O)O)Cl)O  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Dining | 
| Addition Purposes | Sterilization, Antiseptic | 
| Molecular Synonyms | 
        
            Demeclocycline
        
            Demethylchlortetracycline
        
            DMCT
        
            Ledermycin
        
            Demethylchlortetracyclin
        
            Demeclociclina
        
            7-Chloro-6-demethyltetracycline
        
            Novotriclina
        
            Demeclocyclinum
        
            6-Demethyl-7-chlorotetracycline
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:43 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 464.9 | 
| Hydrogen Bond Donor Count | 6 | 
| Hydrogen Bond Acceptor Count | 9 | 
| Rotatable Bond Count | 2 | 
| Complexity | 961 | 
| Monoisotopic Mass | 464.0986433 | 
| Exact Mass | 464.0986433 | 
| XLogP | 0.7 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 32 | 
| Defined Atom Stereocenter Count | 5 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9659 | 
| Human Intestinal Absorption | HIA+ | 0.8161 | 
| Caco-2 Permeability | Caco2+ | 0.5000 | 
| P-glycoprotein Substrate | Substrate | 0.7387 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8835 | 
| Non-inhibitor | 0.8615 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9375 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7961 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8197 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8739 | 
| CYP450 3A4 Substrate | Substrate | 0.6802 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8995 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8851 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5128 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9949 | 
| Non-inhibitor | 0.5633 | |
| AMES Toxicity | Non AMES toxic | 0.8478 | 
| Carcinogens | Non-carcinogens | 0.9182 | 
| Fish Toxicity | High FHMT | 0.9828 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9775 | 
| Honey Bee Toxicity | Low HBT | 0.7181 | 
| Biodegradation | Not ready biodegradable | 1.0000 | 
| Acute Oral Toxicity | IV | 0.6225 | 
| Carcinogenicity (Three-class) | Non-required | 0.6202 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -2.5829 | LogS | 
| Caco-2 Permeability | 0.6236 | LogPapp, cm/s | 
| Rat Acute Toxicity | 1.8691 | LD50, mol/kg | 
| Fish Toxicity | 0.8602 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.6276 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0088 | 
| Food Image | ![]()  | 
        
| Food Name | Raw aquatic products | 
| Food Chinese Name | 生食水产品 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
