Demeclocycline
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0333 |
| Substance Name | Tetracycline |
| Substance Chinese Name | 四环素类药物 |
| Molecular Name | Demeclocycline |
| Molecular Chinese Name | 去甲金霉素 |
| 2D Structure | |
| CAS Number | None |
| PubChem CID | 54680690 |
| Formula | C21H21ClN2O8 |
| IUPAC Name | (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| InChI Key | GUXHBMASAHGULD-SEYHBJAFSA-N |
| InChI | InChI=1S/C21H21ClN2O8/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31/h3-4,6-7,14-15,25-27,30,32H,5H2,1-2H3,(H2,23,31)/t6-,7-,14-,15-,21-/m0/s1 |
| Canonical SMILES | CN(C)C1C2CC3C(C4=C(C=CC(=C4C(=C3C(=O)C2(C(=C(C1=O)C(=O)N)O)O)O)O)Cl)O |
| Isomeric SMILES | CN(C)[C@H]1[C@@H]2C[C@@H]3[C@@H](C4=C(C=CC(=C4C(=C3C(=O)[C@@]2(C(=C(C1=O)C(=O)N)O)O)O)O)Cl)O |
| CFM-ID 3.0 | URL Link |
| Related links | Dining |
| Addition Purposes | Sterilization, Antiseptic |
| Molecular Synonyms |
Demeclocycline
Demethylchlortetracycline
DMCT
Ledermycin
Demethylchlortetracyclin
Demeclociclina
7-Chloro-6-demethyltetracycline
Novotriclina
Demeclocyclinum
6-Demethyl-7-chlorotetracycline
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:43 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 464.9 |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 2 |
| Complexity | 961 |
| Monoisotopic Mass | 464.0986433 |
| Exact Mass | 464.0986433 |
| XLogP | 0.7 |
| Formal Charge | 0 |
| Heavy Atom Count | 32 |
| Defined Atom Stereocenter Count | 5 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9659 |
| Human Intestinal Absorption | HIA+ | 0.8161 |
| Caco-2 Permeability | Caco2+ | 0.5000 |
| P-glycoprotein Substrate | Substrate | 0.7387 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8835 |
| Non-inhibitor | 0.8615 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9375 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7961 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8197 |
| CYP450 2D6 Substrate | Non-substrate | 0.8739 |
| CYP450 3A4 Substrate | Substrate | 0.6802 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8995 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8851 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5128 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9949 |
| Non-inhibitor | 0.5633 | |
| AMES Toxicity | Non AMES toxic | 0.8478 |
| Carcinogens | Non-carcinogens | 0.9182 |
| Fish Toxicity | High FHMT | 0.9828 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9775 |
| Honey Bee Toxicity | Low HBT | 0.7181 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | IV | 0.6225 |
| Carcinogenicity (Three-class) | Non-required | 0.6202 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.5829 | LogS |
| Caco-2 Permeability | 0.6236 | LogPapp, cm/s |
| Rat Acute Toxicity | 1.8691 | LD50, mol/kg |
| Fish Toxicity | 0.8602 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.6276 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0088 |
| Food Image | ![]() |
| Food Name | Raw aquatic products |
| Food Chinese Name | 生食水产品 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
