Chlortetracycline
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0334 | 
| Substance Name | Tetracycline | 
| Substance Chinese Name | 四环素类药物 | 
| Molecular Name | Chlortetracycline | 
| Molecular Chinese Name | 金霉素 | 
| 2D Structure | |
| CAS Number | 57-62-5 | 
| PubChem CID | 54675777 | 
| Formula | C22H23ClN2O8 | 
| IUPAC Name | (4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide | 
| InChI Key | DHPRQBPJLMKORJ-XRNKAMNCSA-N | 
| InChI | InChI=1S/C22H23ClN2O8/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21/h4-5,7-8,15,26-27,30,32-33H,6H2,1-3H3,(H2,24,31)/t7-,8-,15-,21-,22-/m0/s1 | 
| Canonical SMILES | CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O  | 
| Isomeric SMILES | C[C@@]1([C@H]2C[C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Dining | 
| Addition Purposes | Sterilization, Antiseptic | 
| Molecular Synonyms | 
        
            Chlortetracycline
        
            7-Chlorotetracycline
        
            57-62-5
        
            Clortetraciclina
        
            Chlortetracyclinum
        
            AUREOMYCIN
        
            UNII-WCK1KIQ23Q
        
            WCK1KIQ23Q
        
            Aureomykoin
        
            Chlorotetracycline
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:43 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 478.9 | 
| Hydrogen Bond Donor Count | 6 | 
| Hydrogen Bond Acceptor Count | 9 | 
| Rotatable Bond Count | 2 | 
| Complexity | 1010 | 
| Monoisotopic Mass | 478.1142934 | 
| Exact Mass | 478.1142934 | 
| XLogP | -1.3 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 33 | 
| Defined Atom Stereocenter Count | 5 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9707 | 
| Human Intestinal Absorption | HIA+ | 0.8224 | 
| Caco-2 Permeability | Caco2+ | 0.6302 | 
| P-glycoprotein Substrate | Substrate | 0.7841 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8316 | 
| Non-inhibitor | 0.7581 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9376 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7786 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7968 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8771 | 
| CYP450 3A4 Substrate | Substrate | 0.6961 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9046 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8734 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5745 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9956 | 
| Non-inhibitor | 0.6021 | |
| AMES Toxicity | Non AMES toxic | 0.8911 | 
| Carcinogens | Non-carcinogens | 0.9182 | 
| Fish Toxicity | High FHMT | 0.9938 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9846 | 
| Honey Bee Toxicity | Low HBT | 0.6779 | 
| Biodegradation | Not ready biodegradable | 1.0000 | 
| Acute Oral Toxicity | III | 0.5284 | 
| Carcinogenicity (Three-class) | Non-required | 0.6484 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -2.9039 | LogS | 
| Caco-2 Permeability | 0.7737 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.1711 | LD50, mol/kg | 
| Fish Toxicity | 0.8042 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.6815 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0088 | 
| Food Image | ![]()  | 
        
| Food Name | Raw aquatic products | 
| Food Chinese Name | 生食水产品 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
Clomocycline  | 
            
            
            
            
            DrugBank  | 
            Link  | 
        
