Doxycycline
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0336 | 
| Substance Name | Tetracycline | 
| Substance Chinese Name | 四环素类药物 | 
| Molecular Name | Doxycycline | 
| Molecular Chinese Name | 强力霉素 | 
| 2D Structure | |
| CAS Number | 564-25-0 | 
| PubChem CID | 54671203 | 
| Formula | C22H24N2O8 | 
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide | 
| InChI Key | SGKRLCUYIXIAHR-AKNGSSGZSA-N | 
| InChI | InChI=1S/C22H24N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-7,10,14-15,17,25-27,30,32H,1-3H3,(H2,23,31)/t7-,10+,14+,15-,17-,22-/m0/s1 | 
| Canonical SMILES | CC1C2C(C3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O  | 
| Isomeric SMILES | C[C@@H]1[C@H]2[C@@H]([C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Dining | 
| Addition Purposes | Sterilization, Antiseptic | 
| Molecular Synonyms | 
        
            Doxycycline
        
            Vibramycin
        
            Doxytetracycline
        
            564-25-0
        
            Doxiciclina
        
            Monodox
        
            Oracea
        
            Vibra-tabs
        
            Doxy-Caps
        
            Doxycyclinum
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:44 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 444.4 | 
| Hydrogen Bond Donor Count | 6 | 
| Hydrogen Bond Acceptor Count | 9 | 
| Rotatable Bond Count | 2 | 
| Complexity | 956 | 
| Monoisotopic Mass | 444.15326574 | 
| Exact Mass | 444.15326574 | 
| XLogP | -0.7 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 32 | 
| Defined Atom Stereocenter Count | 6 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9881 | 
| Human Intestinal Absorption | HIA+ | 0.8500 | 
| Caco-2 Permeability | Caco2- | 0.8706 | 
| P-glycoprotein Substrate | Substrate | 0.6990 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8038 | 
| Non-inhibitor | 0.8628 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9562 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7882 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8008 | 
| CYP450 2D6 Substrate | Non-substrate | 0.9116 | 
| CYP450 3A4 Substrate | Substrate | 0.6551 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9144 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9293 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9099 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8567 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8086 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9946 | 
| Non-inhibitor | 0.7466 | |
| AMES Toxicity | Non AMES toxic | 0.9132 | 
| Carcinogens | Non-carcinogens | 0.8632 | 
| Fish Toxicity | High FHMT | 0.9608 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9489 | 
| Honey Bee Toxicity | Low HBT | 0.6149 | 
| Biodegradation | Not ready biodegradable | 0.9941 | 
| Acute Oral Toxicity | III | 0.7981 | 
| Carcinogenicity (Three-class) | Non-required | 0.7022 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -3.0711 | LogS | 
| Caco-2 Permeability | 0.5625 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.3159 | LD50, mol/kg | 
| Fish Toxicity | 0.5953 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.5989 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0088 | 
| Food Image | ![]()  | 
        
| Food Name | Raw aquatic products | 
| Food Chinese Name | 生食水产品 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
Doxycycline  | 
            
            
            
            
            DrugBank  | 
            Link  | 
        
