Amoxicillin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0342 |
| Substance Name | Beta lactamides |
| Substance Chinese Name | Β-内酰胺类药物 |
| Molecular Name | Amoxicillin |
| Molecular Chinese Name | 羟氨苄青霉素 |
| 2D Structure | |
| CAS Number | 26787-78-0 |
| PubChem CID | 33613 |
| Formula | C16H19N3O5S |
| IUPAC Name | (2S,5R,6R)-6-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChI Key | LSQZJLSUYDQPKJ-NJBDSQKTSA-N |
| InChI | InChI=1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24)/t9-,10-,11+,14-/m1/s1 |
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=C(C=C3)O)N)C(=O)O)C |
| Isomeric SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)C(=O)O)C |
| CFM-ID 3.0 | URL Link |
| Related links | Dining |
| Addition Purposes | Sterilization, Antiseptic |
| Molecular Synonyms |
Amoxicillin
Amoxycillin
26787-78-0
Amoxicillin anhydrous
Amoxicilline
P-Hydroxyampicillin
Amoxicillinum
Amopenixin
Amoxicilina
Amolin
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 365.4 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 4 |
| Complexity | 590 |
| Monoisotopic Mass | 365.1045419 |
| Exact Mass | 365.1045419 |
| XLogP | -2 |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9967 |
| Human Intestinal Absorption | HIA- | 0.9008 |
| Caco-2 Permeability | Caco2- | 0.8722 |
| P-glycoprotein Substrate | Substrate | 0.5741 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9665 |
| Non-inhibitor | 0.9968 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9636 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.4840 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8430 |
| CYP450 2D6 Substrate | Non-substrate | 0.8446 |
| CYP450 3A4 Substrate | Non-substrate | 0.5478 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9070 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9150 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8309 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9767 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9996 |
| Non-inhibitor | 0.8761 | |
| AMES Toxicity | Non AMES toxic | 0.9099 |
| Carcinogens | Non-carcinogens | 0.5439 |
| Fish Toxicity | High FHMT | 0.9725 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.7245 |
| Honey Bee Toxicity | Low HBT | 0.6935 |
| Biodegradation | Not ready biodegradable | 0.9606 |
| Acute Oral Toxicity | IV | 0.5992 |
| Carcinogenicity (Three-class) | Non-required | 0.6829 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.0180 | LogS |
| Caco-2 Permeability | -0.0502 | LogPapp, cm/s |
| Rat Acute Toxicity | 1.7036 | LD50, mol/kg |
| Fish Toxicity | 1.5222 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.2039 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0088 |
| Food Image | ![]() |
| Food Name | Raw aquatic products |
| Food Chinese Name | 生食水产品 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
