Amoxicillin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0342 | 
| Substance Name | Beta lactamides | 
| Substance Chinese Name | Β-内酰胺类药物 | 
| Molecular Name | Amoxicillin | 
| Molecular Chinese Name | 羟氨苄青霉素 | 
| 2D Structure | |
| CAS Number | 26787-78-0 | 
| PubChem CID | 33613 | 
| Formula | C16H19N3O5S | 
| IUPAC Name | (2S,5R,6R)-6-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | 
| InChI Key | LSQZJLSUYDQPKJ-NJBDSQKTSA-N | 
| InChI | InChI=1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24)/t9-,10-,11+,14-/m1/s1 | 
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=C(C=C3)O)N)C(=O)O)C  | 
| Isomeric SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)C(=O)O)C  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Dining | 
| Addition Purposes | Sterilization, Antiseptic | 
| Molecular Synonyms | 
        
            Amoxicillin
        
            Amoxycillin
        
            26787-78-0
        
            Amoxicillin anhydrous
        
            Amoxicilline
        
            P-Hydroxyampicillin
        
            Amoxicillinum
        
            Amopenixin
        
            Amoxicilina
        
            Amolin
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 365.4 | 
| Hydrogen Bond Donor Count | 4 | 
| Hydrogen Bond Acceptor Count | 7 | 
| Rotatable Bond Count | 4 | 
| Complexity | 590 | 
| Monoisotopic Mass | 365.1045419 | 
| Exact Mass | 365.1045419 | 
| XLogP | -2 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 25 | 
| Defined Atom Stereocenter Count | 4 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9967 | 
| Human Intestinal Absorption | HIA- | 0.9008 | 
| Caco-2 Permeability | Caco2- | 0.8722 | 
| P-glycoprotein Substrate | Substrate | 0.5741 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9665 | 
| Non-inhibitor | 0.9968 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9636 | 
| Distribution | ||
| Subcellular localization | Lysosome | 0.4840 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8430 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8446 | 
| CYP450 3A4 Substrate | Non-substrate | 0.5478 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9070 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9150 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8309 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9767 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9996 | 
| Non-inhibitor | 0.8761 | |
| AMES Toxicity | Non AMES toxic | 0.9099 | 
| Carcinogens | Non-carcinogens | 0.5439 | 
| Fish Toxicity | High FHMT | 0.9725 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.7245 | 
| Honey Bee Toxicity | Low HBT | 0.6935 | 
| Biodegradation | Not ready biodegradable | 0.9606 | 
| Acute Oral Toxicity | IV | 0.5992 | 
| Carcinogenicity (Three-class) | Non-required | 0.6829 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -3.0180 | LogS | 
| Caco-2 Permeability | -0.0502 | LogPapp, cm/s | 
| Rat Acute Toxicity | 1.7036 | LD50, mol/kg | 
| Fish Toxicity | 1.5222 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.2039 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0088 | 
| Food Image | ![]()  | 
        
| Food Name | Raw aquatic products | 
| Food Chinese Name | 生食水产品 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
